Biology: Life on Earth (11th Edition)
11th Edition
ISBN: 9780134168296
Author: Gerald Audesirk, Teresa Audesirk, Bruce E. Byers
Publisher: PEARSON
expand_more
expand_more
format_list_bulleted
Videos
Textbook Question
Chapter 3, Problem 1FTB
In organic molecules made of chains of subunits, each subunit is called a(n) ______, and the chains are called _____. Carbohydrates consisting of long chains of sugars are called _____. These sugar chains can be broken down by reactions. Three types of carbohydrates consisting of long glucose chains are ________, ______, and ____
Expert Solution & Answer
Want to see the full answer?
Check out a sample textbook solution
Students have asked these similar questions
When two carbohydrates bond, they do so through a reaction called
This produce a molecule called a_____. A molecule comprising numerous carbohydrates is called a______.
Fats have the most potential energy of all the biomolecules because they have the most ___________________ atoms associated with ___________________ atoms.
Your answer should consist of the first blank word with a comma and a space between them. For example: black, white
linoleic acid
polyunsaturated
weaker
higher
more
stearic acid
similar
stronger
saturated
lower
less
Chapter 3 Solutions
Biology: Life on Earth (11th Edition)
Ch. 3 - 1. Polar molecules
a. dissolve in lipids.
b. are...Ch. 3 - Which match is correct? a. monosaccharide-sucrose...Ch. 3 - 3. Which of the following statements is...Ch. 3 - Which of the following is not composed of...Ch. 3 - Prob. 5MCCh. 3 - 1. In organic molecules made of chains of...Ch. 3 - Prob. 2FTBCh. 3 - Proteins are synthesized by a reaction called...Ch. 3 - 4. A nucleotide consists of three parts: ______...Ch. 3 - 5. Fill in the following with the appropriate type...
Ch. 3 - Prob. 1RQCh. 3 - List the four principal classes of biological...Ch. 3 - What roles do nucleotides play in living...Ch. 3 - Prob. 4RQCh. 3 - Prob. 5RQCh. 3 - Describe the synthesis of a protein from amino...Ch. 3 - Where in nature do we find cellulose? Where do we...Ch. 3 - Based on their structure, sketch and explain how...Ch. 3 - Prob. 2ACCh. 3 - In an alternate universe where people could digest...
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, biology and related others by exploring similar questions and additional content below.Similar questions
- Which of the following names best describes the molecule? A. Pentose B. α-glucose C. β-fructose D. L-sugar E. ketosearrow_forwardCells can store energy as starches (long polymer forms of carbohydrates, or sugars) and fats. If you isolate the starch stored by a cell, you would find that a lot of the mass of the isolated starch is actually water. However, if you isolate the fat stored by a cell you would find that very little of the mass of the fat is water. Explain this difference based on the structures or properties of the starch and fat moleculesarrow_forwardMark each of the following statements that are true about carbohydrates: Question 13 options: Carbohydrates are the same thing as sugars. A single glucose molecule is an example of a monomer A single unit of a glucose molecule is referred to as a polysaccharide Carbohydrates store energy in their bonds. Carbohydrates provide structural support for cells in the form of cellulosearrow_forward
- Which of the following bonds stores the greatest amount of chemical energy within a carbohydrate like glucose? O the O-H bond O the C-H bond O the carbonyl (C-O) bond O the C-O bondarrow_forwardWhen the carbohydrate maltose is digested into two glucose monosaccharide sugars (by maltase in the human small intestine), the resulting glucose monomers are properly defined as: the catalysts the substrates the enzymes the reactants the productsarrow_forwardbonds are used to join sugar subunits in a polysaccharide, while bonds are used to join amino acids in a protein. Fill in the blankarrow_forward
- Describe these type of molecules lipids, proteins, or carbohydrates.arrow_forwardProteins are among the most diverse macromolecules because A-they contains both amino groups and carboxyl groups. B-they can twist and fold into many different and complex structures. C-they contains nitrogen as well as carbon, hydrogen, and oxygen. D-their R groups can be either acidic or basic Which of the following statements about cellulose is true? A-Animals make it and use it to store energy. B-Plants make it and use it to store energy. C-Animals make it and use it as part of the skeleton. D-Plants make it and use it to give structural support to cells. A major difference between polysaccharides and proteins is that a-plants make polysaccharides, while animals make proteins. B-proteins are made of monomers, while polysaccharides are not. C-polysaccharides are made of monosaccharides, while proteins are made of amino acids. D-proteins carry genetic information, while polysaccharides do not.arrow_forwardWhich of the following molecules is likely to have the most potential energy? A molecule of glucose A molecule of ATP A molecule of ADP A polysaccharidearrow_forward
- Carbohydrates are biomolecules are complex molecules whose building block is the ___________. Amino acids Sugar 1 nucleotide glycerol and fatty acidsarrow_forwardConsider a hypothetical amino acid whose side chain forms a hydrogen bond with the oxygen atom of a water molecule. Based on this information, which of the following statements is correct? The side chain of the amino acid is hydrophobic. The side chain of the amino acid is negatively charged. It is not possible to determine if the amino acid is positively charged, negatively charged, or hydrophobic. The side chain of the amino acid is positively charged.arrow_forwardThe symbol for the fatty acid below is ________________: ________________, n-____________________. CH3(CH2)2(CH=CHCH2)2(CH2)4COOH (This is a multiple blank question, e.g. for 12:1, n-3 you would enter 12, 1, and 3.)arrow_forward
arrow_back_ios
SEE MORE QUESTIONS
arrow_forward_ios
Recommended textbooks for you
Human Biology (MindTap Course List)BiologyISBN:9781305112100Author:Cecie Starr, Beverly McMillanPublisher:Cengage Learning
Biology Today and Tomorrow without Physiology (Mi...BiologyISBN:9781305117396Author:Cecie Starr, Christine Evers, Lisa StarrPublisher:Cengage Learning
Concepts of BiologyBiologyISBN:9781938168116Author:Samantha Fowler, Rebecca Roush, James WisePublisher:OpenStax College
Human Biology (MindTap Course List)
Biology
ISBN:9781305112100
Author:Cecie Starr, Beverly McMillan
Publisher:Cengage Learning
Biology Today and Tomorrow without Physiology (Mi...
Biology
ISBN:9781305117396
Author:Cecie Starr, Christine Evers, Lisa Starr
Publisher:Cengage Learning
Concepts of Biology
Biology
ISBN:9781938168116
Author:Samantha Fowler, Rebecca Roush, James Wise
Publisher:OpenStax College
GCSE Chemistry - Acids and Bases #34; Author: Cognito;https://www.youtube.com/watch?v=vt8fB3MFzLk;License: Standard youtube license