ChemistryGaseous ethane (CH₂CH,) will react with gaseous oxygen (0.) to produce gaseous carbon dioxide (CO₂) and gaseous water (H₂O). Suppose 3.0 g of ethaneis mixed with 14.8 g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to 2 significantdigits.XG

Answered: Image /qna-images/answer/24dfc2f5-525a-4e00-95a1-79d91180bbad.jpg

Gaseous ethane (CH,CH,) will react with gaseous oxygen (0.) to produce gaseous carbon dioxide (CO) and gaseous water (H,O). Suppose 3.0 g of ethi is mixed with 14.8 g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to 2 significant digits. O

Gaseous ethane (CH,CH,) will react with gaseous oxygen (0.) to produce gaseous carbon dioxide (CO) and gaseous water (H,O). Suppose 3.0 g of ethi is mixed with 14.8 g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to 2 significant digits. O

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.69PAE: 4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to...

See similar textbooks

Similar questions

Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.
3.55 An average person inhales roughly 2.5 g of O2 in a minute. How many molecules of oxygen are inhaled in (a) 1 minute, (b) 1 hour, (c) 1 day by an average person?
Two general chemistry students working together in the lab weigh out 0.832 g of CaCl2 2 H2O into a crucible. After heating the sample for a short time and allowing the crucible to cool, the students determine that the sample has a mass of 0.739 g. They then do a quick calculation. On the basis of this calculation, what should they do next? (a) Congratulate themselves on a job well done. (b) Assume the bottle of CaCl2 2 H2O was mislabeled; it actually contained something different. (c) Heat the crucible again, and then reweigh it.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
Zinc and magnesium metal each reacts with hydrochloric acid to make chloride salts of the respective metals, and hydrogen gas. A 10.00-g mixture of zinc and magnesium produces 0.5171 g of hydrogen gas upon being mixed with an excess of hydrochloric acid. Determine the percent magnesium by mass in the original mixture.
3.68 Magnesium is lighter than other structural metals, so it is increasingly important in the design of more efficient vehicles. Mg2+ ions are present in seawater, and the metal is often prepared by "harvesting" these ions and converting them to Mg metal. The average magnesium content of the oceans is about 1270 g Mg2+ per ton of seawater, and the density of seawater is about 1.03 g/mL. What is the molarity of Mg2+ ions in seawater? The design for a concept car calls for 103 kg of magnesium per vehicle. How many gallons of seawater would be required to supply enough magnesium to build one of these ears?