Answered: Consider the hypothetical…

Consider the hypothetical thermochemical equation 3 A + B2C for which \Delta H = 59.9 kJ/mol. What would AH, in kJ/mol, be for the reaction 9 A+ 3 B-> 6 C?

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter8: Thermochemistry

Section: Chapter Questions

Problem 36QAP: Given the following thermochemical equations: 4B(s)+3O2(g)2B2O3(s)H=2543.8kJ H2(g)+12...

See similar textbooks

Related questions

Q: Which alkyl bromide is necessary to complete the synthesis shown in the box?

A: The carbonyl compound reacts with alkyl lithium to form alcohol. Ketone reacts with alkyl lithium by…

Q: Suppose a 250. mL flask is filled with 0.80 mol of CH 4, 1.6 mol of H2S and 1.0 mol of H2. This…

A: Answer:Molar concentration of gas in a gaseous mixture is always equal to the ratio of its number of…

Q: What mass of precipitate (in g) is formed when 20.5 mL of 0.500 M Cu(NO₃)₂ reacts with 15.0 mL of…

A: The objective of this question is to find out the mass of the precipitate formed when a certain…

Q: What is the change in enthalpy in kilojoules when 2.30 mol of Mg solid is completely reacted…

A: ∆H = -1384.6 kJExplanation:The problem asks for the total change in enthalpy when 2.30 mol solid Mg…

Q: A student suggests that the molecule on the right can be made from a single molecule that doesn't…

A: The proper structure is drawn out in section below -Explanation:Here is the correct structure which…

Q: Homework: Construct a titration curve for 10 mL 0.01 M NaNH₂ titrated by 0.01 M HCl in NH3 solvent.…

A: As per the given question i was provided the solution i hope it will helps you.Explanation:Step…

Q: Which of the following molecules are isomers? - I and II || = I and III II and III all of the them…

Q: The activation energy of a reaction is 50.5 kJ/mol and the frequency factor is 1.9\times 1011/s.…

A: Arrhenius equation is ln ( k ) = - + ln ( A ) Wherek = rate constantA = frequency factorEa =…

Q: Draw the major product of this reaction. Ignore inorganic byproducts. CI о 1. LiAl(OEt)3H, -78 °C 2.…

A: -> LiAl(OEt)3H is reducing agent but it is weaker reducing agent than LiAlH4 .It can also reduce…

Q: Complete the table below by deciding whether a precipitate forms when aqueous solutions A and B are…

A: Given, Solution A Solution B Does a precipitation forms when A and B…

Q: STARTING AMOUNT What mass in grams are in 5.32 × 1022 molecules of CO2 ?

Q: A student heats 84.17mL of water to 95.27°C using a hot plate. The heated water is added to a…

A: At thermal equilibrium Heat loss by hot water = heat gain by cold water + heat gain by…

Q: reaction vessel compound concentration expected change in concentration CH2CH2NH₂ 0.77 M ○ ↑…

A: The direction in which the reaction proceeds to reach equilibrium can be predicted by determining…

Q: Draw step 2 of the mechanism by completing the starting materials. wwww H₂C + NH; + Z +1 +1 +1 +1 1…

A: The question is based on Acid-Base reaction in the organic chemistry.

Q: Calculate the pH for each of the cases in the titration of 25.0 mL. of 0.220 M pyridine, CH,N(aq)…

Q: Using the two images attached please write one paragraph EXPLAINING THE ANALYSIS Please please…

A: The objective of this question is to understand the principles and procedures involved in the…

Q: 2. Draw a curved arrow mechanism for each of the following reactions. KOH heat H₂O S H₂O KOH (cat.)

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: Match the lipid pathway with its description Question 27 options: dietary…

A: The objective of the question is to match the lipid pathway with its corresponding description.

Q: Only typed solution

A: The objective of the question is to identify the possible product formed in the vial due to the…

Q: A 510 mL buffer solution is 0.105 M in HNO2 and 0.165 M in KNO Identify whether each addition would…

A: We can calculate moles of any substance using the formula below: n=MV, where n is the number of…

Q: Which of the structures below are drawn incorrectly using the conventions of line angle drawings?…

A: The proposed structure must adhere to the fundamental chemical rules and principles, such as the…

Q: The equilibrium constant for the chemical equation N2(g) + 3H2(g)2NH3(g) is Kp = 0.180 at 213 °C.…

A: Given reaction,The pressure equilibrium constant,The temperature of the gas,The concentration…

Q: What mass of precipitate (in g) is formed when 45.5 mL of 0.300 M K₃PO₄ reacts with 54.5 mL of 0.200…

A: The mass of CrPO4 precipitate formed is approximately 1.602 g.Explanation:The balanced chemical…

Q: Consider the representation depicted in the molecular art for the reaction A + B C + D with an…

A: The given reaction is: So, the equilibrium constant of this reaction =

Q: Ts Ts= ZO Dj O=S=O + 2 N=C= t-BuO K H NEC EtOH, CH2Cl2 4

A: Van Leusen reaction:This reaction involves conversion of ketones to nitriles with one additional…

Q: How many stereoisomers are there for the compound shown? OH NH O 1 02 03 04 05

A: The objective of the question is to determine how many stereoisomers are possible for the given…

Q: 4. A 500 ml solution of KOH was found to have a pH of 12.55. Calculate the concentration of [OH] in…

A: The pH value of a solution can be used as a measure of the concentration of hydronium ion (H3O+)…

Q: Please draw all possible resonance structures, provided with an explanation

A: The answer of this question is given below. Please go through that. Explanation: Follow the…

Q: 5. Consider a molecular solid such as anthracene. It belongs to a monoclinic space group P2₁/a. a=…

A: The objective of the question is to understand the structure of the molecular solid anthracene,…

Q: Write the reagent or draw structures of the starting material or organic product(s) in the following…

A: (a) Elimination reaction(b) Aromatic electrophilic substitution reaction

Q: 0) Propose a synthesis for the following molecules, Starting from benzene or a named varient. شمیر…

A: NOTE: As per our company guidelines we are supposed to answer only first 3 sub-parts. Kindly repost…

Q: 2) Provide an arow-pushing mechanism for the reaction shown below. HO OH [H2SO4] I

A: Diols react with aldehydes and ketones in the presence of an acid catalyst to yield acetals in a…

Q: Mechanism 1. Provide the complete mechanism for the reaction below. You must include appropriate…

A: Diels-Alder reaction is a type of electrocyclic reaction which involves the cycloaddition between…

Q: Determine whether each of the following compounds could be removed from an organic solvent by…

A: Solubility is the ability of a substance to interact with a solvent and form a solution. The ability…

Q: (a) A 40 mL sample of 0.100 M HNO2 (pKa = 3.34) is titrated with 0.200 M NaOH. Find the pH after…

A: The objective of this question is to find the pH at different stages of a titration between a weak…

Q: Atmospheric pressure cm Given a barometric pressure of 733.0 mmHg, calculate the pressure of gas…

A: Answer:Manometer is a U-shaped instrument that is used to measure the pressure of liquid column and…

Q: Arrange the following compounds in order of increasing lattice energy (weakest to strongest), so…

A: The enthalpy change during the formation of one mole of ionic crystal from cations and anions is…

Q: The intermediate formed in the previous step is resonance-stabilized. Draw the missing curved…

Q: Curved arrows are used to illustrate the flow of electrons. Use the reaction conditions provided and…

A: Given,The reaction mechanistic step:

Q: Draw the skeletal structure of a triacylglycerol that contains three molecules of caproic acid.…

A: answer is given belowExplanation:Caproic acid, also known as hexanoic acid, has the chemical formula…

Q: 20. For the following chair flip, the equatorial position of the methyl group is favored over the…

A: The value of standard free energy change (ΔGo) can be calculated using the following data-Here, R is…

Q: Select the correct final major product. A 1. B 2. 0 3. D 4. 1) O CH₁₂ + major product + Br 1. Mg,…

A: When an alkyl bromide reacts with magnesium (Mg) in diethyl ether (Et2O), it forms a Grignard…

Q: Θ HO:- NaOH H₂O OH

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: In the laboratory you are given the task of separating Ag* and Ba²+ ions in aqueous solution. For…

A: According to solubility rules, All sulfates are soluble except Ca+2, Ba+2, Ag+, Pb+2, Sr+2, Hg+2.…

Q: A student needs to prepare a buffer made from HCO3 and with pH 6.690. If Ka for H2CO3 is 4.20 x…

A: Ka of H2CO3 = 4.2010-7pH = 6.690

Q: help me with these two parts please

A: i) oneii) twoExplanation:Entities:i (possibly molecule 1)ii (possibly molecule 2)H (Hydrogen…

Q: 2. 13.9 g of ammonium nitrate is dissolved in a total volume of 225 mL in a coffee cup calorimeter.…

A: Given:Mass of ammonium nitrate dissolved = 13.9 gTotal volume = 225 mLInitial temperature of the…

Q: An organic chemistry Teaching Assistant (TA) suggested in your last discussion section that there is…

A: Structure of the questions is given in Step.Explanation:Step 1:

Q: Benzoic acid has a Ka -6.3 x 10-5. What is the percent ionized in a 0.11 M solution of benzoic acid?…

A: Final answer is given in explanation please see from there.Explanation:Approach to solving the…

Q: Calculate the pH of a solution prepared from 0.211 mol of NH4CN and enough water to make 1.00 L of…

A: The given solution is NH4CN. Number of moles of NH4CN = 0.211 molVolume of the solution = 1.00 LKa…

Question

Consider the hypothetical thermochemical equation 3 A
+ B2C for which \Delta H = 59.9 kJ/mol. What
would AH, in kJ/mol, be for the reaction 9 A+ 3 B-> 6
C?

AI-Generated Solution

AI-generated content may present inaccurate or offensive content that does not represent bartleby’s views.

Unlock instant AI solutions

Tap the button
to generate a solution

Click the button to generate
a solution

SEE SOLUTION

Similar questions

When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
The thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?
Nitric acid, HNO3, can be prepared by the following sequence of reactions: 4NH3(g)+5O2(g)4NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(l)+NO(g) How much heat is evolved when 1 mol of NH3(g) is converted to HNO3(l)? Assume standard states at 25 C.
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
Use Appendix L to find the standard enthalpies of formation of oxygen atoms, oxygen molecules (O2), and ozone (O3). What is the standard state of oxygen? Is the formation of oxygen atoms from O2 exothermic? What is the enthalpy change for the formation of 1 mol of O3 from O2?
How much heat is produced when loo mL of 0.250 M HCl (density, 1.00 g/mL) and 200 mL of 0.150 M NaOH (density, 1.00 g/mL) are mixed? HCl(aq)+NaO(aq)NaCl(aq)+H2O(l)H298=58kJ If both solutions are at the same temperature and the heat capacity of the products is 4.19 J/g C, how much will the temperature increase? What assumption did you make in your calculation?
An industrial process for manufacturing sulfuric acid, H2SO4, uses hydrogen sulfide, H2S, from the purification of natural gas. In the first step of this process, the hydrogen sulfide is burned to obtain sulfur dioxide, SO2. 2H2S(g)+3O2(g)2H2O(l)+2SO2(g);H=1124kJ The density of sulfur dioxide at 25C and 1.00 atm is 2.62 g/L, and the molar heat capacity is 30.2 J/(mol C). (a) How much heat would be evolved in producing 1.00 L of SO2 at 25C and 1.00 atm? (b) Suppose heat from this reaction is used to heat 1.00 L of the SO2 from 25C to 500C for its use in the next step of the process. What percentage of the heat evolved is required for this?
The addition of 3.15 g of Ba(OH)28H2O to a solution of 1.52 g of NH4SCN in loo g of water in a calorimeter caused the temperature to fall by 3.1 C. Assuming the specific heat of the solution and products is 4.20 J/g C, calculate the approximate amount of heat absorbed by the reaction, which can be represented by the following equation: Ba(OH)28H2O(s)+2NH4SCN(aq)Ba(SCN)2(aq)+2NH3(aq)+10H2O(l)
Given the following thermochemical equations: 4B(s)+3O2(g)2B2O3(s)H=2543.8kJ H2(g)+12 O2(g)H2O(g)H=241.8kJ B2H6(s)+3O2B2O3(s)+3H2O(g)H=2032.9kJ Calculate H for the decomposition of B2H6 into its elements.
How much will the temperature of a cup (180 g) of coffee at 95 C be reduced when a 45 g silver spoon (specific heat 0.24 J/g C) at 25 C is placed in the coffee and the two are allowed to reach the same temperature? Assume that the coffee has the same density and specific heat as water.