Write an equation for the acid-base reaction between ethylmagnesium iodide and an alcohol. Use curved arrows to show the flow of electrons in this reaction. In addition, show by using appropriate pKa values that this reaction is an example of a stronger acid and stronger base reacting to give a weaker acid and weaker base.

Write an equation for the acid-base reaction between ethylmagnesium iodide and an alcohol. Use curved arrows to show the flow of electrons in this reaction. In addition, show by using appropriate pKa values that this reaction is an example of a stronger acid and stronger base reacting to give a weaker acid and weaker base.

Chemistry for Today: General, Organic, and Biochemistry

9th Edition

ISBN:9781305960060

Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Publisher:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Chapter13: Alcohols, Phenols, And Ethers

Section: Chapter Questions

Problem 13.61E

See similar textbooks

Similar questions

The presence of a pi bond also makes a compound a base. With this in mind, draw the conjugate acid of ethylene, CH2=CH2.
Using pKa Values to Determine Relative Acidity and Basicity Rank the following compounds in order of increasing acidity, and then rank their conjugate bases in order of increasing basicity.
4. The pk, of vanillin is about 9, which is much more acidic than a normal alcohol. Draw a reaction showing the deprotonation of vanillin with NaOH, and then draw six resonance structures of the conjugate base. Draw the hybrid structure and clearly indicate how the negative charge is distributed in the compound.
2.) Draw the products of the following reactions. Provide an arrow-pushing mechanism for each reaction. Label the acid, base, conjugate base, and conjugate acid. Finally, indicate the direction of equilibrium. 요요 + NaH
4-Methylphenol is more acidic than ethanol (pKa 10.36 vs 16.0) , even though both contain an OH group and a methyl group. Draw the structures of the anions formed from loss of the alcoholic protons from both compounds. Use resonance to explain the difference in their respective acidities.
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
Will acetylene react with sodium hydride according to the following equation to form a salt and hydrogen, H2? Using pKa values given in Table 4.1, calculate Keq for this equilibrium.
Rank the following compounds in their correct order of acidity. 1=Most acidic and 4=least acidic.
Arrange the following molecules in increasing order of acidity. Base it only on their structural differences and explain how it is so. 1. HF, CH3CH2CH2OH, CH3CH2COOH 2. Ethyl amine, Ethanol, Propane
1. Rank the following species in order of increasing acidity. Explain your reasons for ordering them as you do. HF NH3 H2SO4 CH3OH CH3COOH H3O+ H2O2. Consider the following compounds that vary from nearly nonacidic to strongly acidic. Draw the conjugate bases of these compounds, and explain why the acidity increases so dramatically with substitution by nitro groups. CH4 CH3NO2 CH2(NO2)2 CH(NO2)3
A carboxylic acid has two oxygen atoms, each with two nonbonding pairs of electrons.(a) Draw the resonance forms of a carboxylic acid that is protonated on the hydroxyoxygen atom.(b) Compare the resonance forms with those given previously for an acid protonated on thecarbonyl oxygen atom
The C-H bond in acetone, (CH3)C=O, has a pką of 19.2. Draw two resonance structures for its conjugate base. Then, explain why acetone is much more acidic than propane, CH;CH,CH3 (pKa = 50). %3D