What type of chemical reaction does carboxylic acid undergo in the following situations? 1. synthesis of methyl salicylate 2. reaction with strong alkali 3. occurs in aqueous solution 4. release of hydrogen gas

What type of chemical reaction does carboxylic acid undergo in the following situations? 1. synthesis of methyl salicylate 2. reaction with strong alkali 3. occurs in aqueous solution 4. release of hydrogen gas

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter22: Substituted Hydrocarbons And Their Reactions

Section22.3: Carbonyl Compounds

Problem 17SSC

See similar textbooks

Related questions

Q: Are carboxylic acids or carboxylate ions more acidi

A: Please find your solution below : Carboxylic acid after donating its proton becomes a negatively…

Q: What type of chemical reaction does carboxylic acid undergo in the following situations? 17.…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Define Spectroscopic Properties of carboxylic acid derivatives ?

A: Dear student, this question is related to the spectroscopy.

Q: Many drugs are sold as their hydrochloride salts (R2NH2 + Cl−), formed by reaction of an amine…

A: Secondary amine on reaction with hydrochloride results in formation of hydrochloride salt. The…

Q: 1. The structure of the amino acid alanine is shown below: i. Identify the most acidic and most…

A: The question is based on the concept of amino acids. we have been given alanine amino acid. we have…

Q: After separating the acidic and neutral compounds in a mixture, how does one recover the neutral…

A: It is given that mixture contains acidic and neutral compounds Now to separate them, we can increase…

Q: Part 1. TRUE or FALSE.Choose A if the statement is true. Choose D if the statement is false. 1.…

A: 1) D statement is false Lewis acid as an electrophile (which is electron poor), and a Lewis base as…

Q: Using the data in Appendix C, determine which of the following bases is strong enough to deprotonate…

A: Reason for correct answer: (a) The deprotonation of an acid takes place in the presence of a strong…

Q: Calculate the concentration of C6H6O62- in an aqueous solution of 4.66×10-2 M ascorbic acid,…

A: Molarity is defined as total number of moles of solute present in 1000 ml of solution Molarity =…

Q: Draw the products of the acid–base reaction when a. HCl is the acid and NH3 is the base. b. H2O is…

Q: 1. The distinguishing chemical property that both an amine and ammonia share is both are weak bases.…

A: 1) The product formed by the reaction of ammonia with HCl is, NH3 + HCl → N+H4Cl- The reaction…

Q: Protein hydrolysis occurs in cells to provide amino acids for the synthesis of new proteins and…

Q: Indole and pyridine rings are found in alkaloids.a. Sketch each ring.b. Name one compound containing…

A: a) The structure of Indole and pyridine rings is shown below,

Q: A carboxylic acid has two oxygen atoms, each with two nonbonding pairs of electrons.(a) Draw the…

A: Carboxylic acids are the compounds that contain carboxyl functional group. The general formula of…

Q: t properties do amines have? They are negatively charged They are bases They are a

A: Functional groups are attached to the hydrocarbon chain and provide them the distinct chemical and…

Q: Amino acids such as glycine are the building blocks of large molecules called proteins that give…

A: a) The reason of glycine does not actually exist in the form with all atoms uncharged, but actually…

Q: Amide formation involves which two functional groups? A.carboxylic acid and alcohol…

A: It is derivative of carboxylic acid . The primary and secondary amide form hydrogen bond…

Q: What is the identity of the gas that forms when vinegar is added to baking powder?

Q: A carboxylic acid has two oxygen atoms, each with two nonbonding pairs of electrons.(a) Draw the…

A: a).

Q: Rank these structures by increasing acidity. (Show names of compounds)

Q: Compare aldehydes and ketones as to: (Use acetaldehyde and acetone as examples). A. Reaction with…

A: Aldehydes are compounds –CHO functional group with a carbonyl center, with carbon boded to a…

Q: When added to water, ethylamine undergoes the following reaction: C2H5NH2 + H2O C2H5NH3+ + OH- Is…

Q: The flavor and odor of fruits comes primarily from the esters they contain. For example, a major…

A: Please find below the reaction mechanism.

Q: What is the proper way to balance an the reaction of benzoic acid with sodium hydroxide to form…

A: The given reaction of benzoic acid with sodium hydroxide goes same like a usual acid-base…

Q: Which of the following will require heat and catalyst for hydrolysis?

A: In this question four compounds are given and asked in which compound for hydrolysis heat and…

Q: Complete the table. [K: /18] Type of What type of reaction is involved in the If there is a reverse…

A: The answer is as follows:

Q: What type of chemical reaction does carboxylic acid undergo in the following situations? 1.…

A: -COOH group is known as carboxilic acid group. At different condition, it gives different product.

Q: How can the structure of the following molecule be changed in order to make it more acidic? A.…

A: The given question details with several properties of carbonyl functionality.

Q: what priority functional group of ff organic compound? a. carboxyl b. hydroxide c. hydroxyl d.…

Q: Which of the following organic compounds is the most soluble in water. Question 15 options:…

A: Functional group is group of atoms responsible for characteristic reactions of particular compound.…

Q: Carboxylic acids are weak acids and dissociate in water. What species is formed by the dissociation…

A: B option is correct.

Q: Complete and balance equations for the hydrolysis of each ester in aqueous sodium hydroxide. Show…

Q: Hydrolysis of ester (Note odor produced and reaction to litmus.) Odor of the ester: Color change of…

A: When carboxylic acid and Alcohol Combine with each other, in presence of concentrated Sulfuric acid,…

Q: Consider the reaction below to answer the following questions. HÇI H,0 HO a. The first nucleophile…

Q: The purity of the aspirin sample is tested with iron (III) chloride. A purple color resulting from…

A: Aspirin is acetyl salicylic acid. It is a white crystalline substance. Purity of aspirin is done by…

Q: What is true regarding protein backbones? The protein backbone is different for each protein and…

A: Proteins are the chain of amino acid that assembe through peptide bonds.Proteins are generally high…

Q: 1. what grouo does the ff organic compound belong? a. ketone b. ether c. cyloalkane d. esther 2.…

Q: Rank the following alcohols in Question # 28 (1, 2, 3 & 4) (pdf document) from least acidic to most…

A: Alcohols are weakly acidic in nature. These are less acidic than phenols and Carboxylic acids, but…

Q: Ammonia (NH3) serves as a/an --- when treated with water to produce an ammonium ion (NH4+) and a…

A: Given :- NH3 + H2O → NH4+ + OH- To determine :- nature of NH3 molecule in above reaction i.e.…

Q: There are compounds called carboxylic acids that are composed of carbon, oxygen, and hydrogen. An…

A: We are given that acids have bad smells, where as ionic salts like NaCl, NaHCO3 etc. are odorless.

Q: Amino acids such as glycine are the building blocks of large molecule.called proteins that give…

A: a) Since in the structure of glycine we can see that there is a N with lone pair electron and an…

Q: Greetings and thank you for your help 1. 30 mL of 0.10M NaOH neutralised 25.0mL of hydrochloric…

A: “Since there are multiple questions and it is not mentioned that which one has to be solved so I am…

Q: Write the condensed formulas of the following names of organic compounds. (a). 6-oxo-3-octenoic acid…

A: Given compounds: (a). 6-oxo-3-octenoic acid (b). 4-phenyl-3-penten-2-ol

Q: a.) For which of the following compounds is it hazardous to breathe dust/vapor /fumes:…

A: Answer (a.) Acetylsalicylic acid -------not hazardous. Acetic acid ---------- not hazardous.…

Q: C. Amides 1. Amidation a. Acetic acid + ammonia b. Aniline + ammonia

A: "Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: carboxylic acids react with water to form sodium hydroxide True False carboxylic acids react with…

A: Carboxylic acids are considered as strong acid. When carboxylic acid is allowed to react with water,…

Q: What particles are present after hydrolysis of NH4Cl?

A: NH4Cl is the formed by NH3 and HCl

Q: Carboxylic acids and Acid Derivatives 3.1 H3C CH,(CH,),OH H,SO, H3C (CH,CH,),NH H. DCC

Q: Complete each equation and indicate if reactants or products are favored. Label each acid or base.…

A: Acids and bases are defined as proton donors or acceptors on the basis of Bronsted-Lowry theory.…

Q: Section 1: (a) Circle the compound which undergoes decarboxylation when heated. HO2C HO2C CO,H (b)…

A: The reaction in which there is a loss of carbon dioxide molecule is called a decarboxylation…

Question

Definition Definition Transformation of a chemical species into another chemical species. A chemical reaction consists of breaking existing bonds and forming new ones by changing the position of electrons. These reactions are best explained using a chemical equation.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What type of chemical reaction does carboxylic acid undergo in the following situations? 17. synthesis of methyl salicylate18. reaction with a strong alkali19. occurs in aqueous solution21. release of hydrogen gas22. production of carboxylate salts23. reaction with acetyl chloride24. one of the reactants is alcohol25. alcohol used as reactant
What type of chemical reaction does carboxylic acid undergo in the following situations? 1. production of carboxylate salts 2. reaction with acetyl chloride 3. one of the reactants in alcohol 4. alcohol used as reactant
1. What are the common derivatives of carboxylic acids? How are they named? 2. What reactions do carboxylic acid derivatives undergo?
Ester compounds often have a sweet, pleasant odor. Many characteristic fruit scents are largely due to the natural presence of one or more ester compounds. As such, artificial scents for foods are often composed of complex mixtures of various esters. The exact identity and ratio of ingredients that compose a particular scent are closely guarded secrets in the food and fragrance industry. Suppose that you are a chemist working for a company that i creating a new line of air fresheners. The company is considering three scents: apple, pear, and pineapple. The project manager has asked you to prepare the ester compounds that are largely responsible for these scents. The structural formulas for these ester compounds are shown here: Alcohols for Air Freshener Project Molar mass Density Cost, per (g/mL) Reagent (g/mol) 1.00 L methanol 32.04 0.79 $46.20 ethanol 46.07 0.79 $112.00 1-propanol 60.10 0.80 $72.70 1-butanol 74.12 0.81 $72.60 Use the structural formulas of the alcohols and…
Complete the table provided below for nomenclature of Carboxylic Acid & Derivatives.
Carboxylic acids can also react with amides to give polyamides (polymers). The same is true with esters and alcohols. Read on lactomer and how it is used for stitches that can dissolve overtime. Why do lactomer stitches dissolve within 2 to 3 weeks following surgery? Refer to the photo below.
Refer to the structures of carboxylic acid and derivatives. Which of the following statements is TRUE? Compound A is the most reactive. The second most reactive is compound B Compound D is the least reactive Compound E is the most reactive.
Compare and contrast acid hydrolysis and base hydrolysis of carboxylic acid derivatives.
arrange the following compound types in order of decreasing ease of hydrolysis: acid halides, acid anhydrides, esters, and amides. Use > in your arrangement.
I. Complete the table. Classification of Carboxylic Acids and its derivatives No. Common Name Structure IUPAC Name 1. CH3CH2CH2COONA COOH(CH2)SCOOH 3. CH3CH2CH2CH2CH2COOH 4. C6HSCOOCOC6H5 5. CICOCH2CH2CH2CH2OH 6. CH3(CH2)7CONH2 7. CH3(CH2)3CH2COOCH2(CH2).CH3 CH3CH2OCOCH2CH2CH2CH2CH2CH2 8. CH3 9. CH3CH2CH2CH2CH2CH2CH2CH2COCI 10. H2NCOCH2CH2CH2CH3 2.
True or false The carboxyl group has the same properties as alcohols and aldehydes. Carboxylic acids have lesser hydrogen bonds relative to aldehydes. Carboxylic acids are carbonyl compounds.
Which reagent describe the following reaction? Ester Carboxylic acid or Carboxylate: which is the conjugate base of carboxylic acid Alcohol Amine Acid Halide Amide Anhydride