What is the role of phosphoric acid in the synthesis of cyclohexene? it is an antioxidant that prevents free radical side reactions it is a safe, non-toxic solvent it lowers the boiling point of the reaction mixture (a colligative property of adding phosphoric acid to water) it protonates the hydroxyl of cyclohexanol to make it a better leaving group

What is the role of phosphoric acid in the synthesis of cyclohexene? it is an antioxidant that prevents free radical side reactions it is a safe, non-toxic solvent it lowers the boiling point of the reaction mixture (a colligative property of adding phosphoric acid to water) it protonates the hydroxyl of cyclohexanol to make it a better leaving group

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter11: Ethers, Epoxides, And Sulfides

Section: Chapter Questions

Problem 11.41P: Aldehydes and ketones react with one molecule of an alcohol to form compounds called hemiacetals, in...

See similar textbooks

Similar questions

Several diamines are building blocks for the synthesis of pharmaceuticals and agro-chemicals. Show how both 1,3-propanediamine and 1,4-butanediamine can be prepared from acrylonitrile.
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.
What is the reduction product of the following compound with H2/Pd? A 2-propyl-1-cyclohexanol B 2-propenyl-1-cyclohexanol C2-propylcyclohexanone D 1-propyl-2-cyclohexanol What is the oxidation product of this compound? H' A ethanoic acid acetic acid propanoic acid D propanone What is the oxidation product of this compound? A 3,4-dimethylpentanoic acid B 2,3-dimethylpentanoic acid C2,3-dimethylpentanone 3,4-dimethylpentanone
What explains why many aldehydes and ketones can undergo self-condensation reactions in basic conditions? The alpha carbon can lose a proton and act like a nucleophile and the carbonyl carbon is an electrophile. The alpha carbon can gain a proton and act like an electrophile and the carbonyl carbon is a nucleophile. The oxygen of the carbonyl group can attack the carbon of the carbonyl group. Only esters can undergo self-condensation reactions.
Acetals are formed from the reaction of two alcohols with a carbonyl under acidic conditions. Acetal formation is faster with 1,2-ethanediol than with two methanol molecules. Choose the factor that explains the difference in reaction rates. A) The reaction with 1,2-ethanediol has a lower AH (enthalpy) of reaction. B) The reaction with 1,2-ethanediol has a higher AH (enthalpy) of reaction. C) The reaction with 1,2-ethanediol has a more favorable entropy of reaction.
Give the main organic product for the following reaction: CH2OH OH H3O* CH3CH2CH2OH OH OH
What explains why many aldehydes and ketones can undergo self- condensation reactions in basic conditions? The alpha carbon can lose a proton and act like a nucleophile and the carbonyl carbon a an electrophile O The alpha carbon can gain a proton and act like an electrophile and the carbonyl carbon is a nucleophile O The oxygen of the carbonyl group can attack the carbon of the carbonyl group Only esters can undergo self-condensation reactions
Name the following organic compound: CH₂ CH₂ H3C CH₂ OH O 2-oxo-5-pentanol O 4-oxo-1-pentanol O 5-hydroxy-2-pentanone O hydroxypentanone O 1-hydroxy-4-pentanone
The presence of what product of the autooxidation of ethers makes the distillation of ethers dangerous?
What is the product formed in the following reaction? HO POCI3 pyridine cyclohexanol