Q: Are triacylglycerols : insoluble in water? very oxidized, contain-glycerol-fatty acids and…
A: Triacylglycerols are non-polar and hydrophobic.
Q: The concentration of cholesterol (C27H46O) in blood is approximately 5.0 mM. How many grams of…
A: Molarity can be expressed in terms of moles and is defined as the amount of solute dissolved per…
Q: A. What is the pH of a 0.15 M solution of acetic acid?
A: The pH of a solution is a measure of its acidity or basicity. It is a scale from 1-14. A lower value…
Q: An acid with a p K a of 8.0 is present in a solution with a pH of 6.0. What is the ratio of the…
A: According to Henderson-Hasselbalch equation pH = pKa + log [A-]/[HA] Given values…
Q: Calculate the pH for a mixture of 0.5 mole of benzoic acid and one mole of sodium benzoate. The pK,…
A: The correct answer is option,g. = 4.2
Q: Ribulose is a ketopentose with the anomeric C on C-2. Will this monosaccharide reduce Benedict’s…
A: A few sugars, like glucose, are labeled as reducing sugar as they are capable of moving electrons…
Q: Desferal (Desferrioxamine B) is a drug given to thalassaemic patients who are being treated by blood…
A: Desferal (Desferrioxamine B)- It is a drug given to thalassaemic patients who are being treated by…
Q: What is the ratio of [isocitrate] to [citrate] under cellular conditions at 37°C?
A: The physiological free energy changes of a reaction determine its fate in the metabolic reaction.…
Q: Amino acids can be prepared from a-halo carboxylic acids [RCH(X)COOH] by reaction with excess NH3.…
A: Amino acids are the organic acids that contains an amino group, carboxyl group, hydrogen atom, and…
Q: Why does the violet color of the Hubble’s reagent fade away in unsaturated fats/oil?
A: a. Fatty acids are classified into saturated and unsaturated fatty acids. b. Saturated fatty acids…
Q: Describe the water solubility of amides in relation to theircarbon chain length.
A: Amides are defined as functional groups. Here a carbonyl carbon atom is linked with the help of a…
Q: B-mercaptoethanol (BME) is used as a reducing agent in biochemistry labs. The structure below…
A: β mercaptoethanol is a reducing agent used to denature proteins by breaking the disulfide bonds…
Q: If you need to make 2L of 0.25M Glucose, how many grams of glucose do you need Formula for glucose:…
A: While conducting experiments in biochemistry or while creating batch cultures of bacteria and for…
Q: The concentration of acetic acid (pKa = 4.75) in vinegar is about 1.0 M. What is the pH of vinegar?
A: The pH of a solution is defined as the negative logarithm of the H3O+ ion concentration in moles per…
Q: conjugate base of the weak acid, CH3COOH in an acid b ace action?
A:
Q: difference between teichoic acid and lipoteichoic acid?
A: Teichoic acids were found in 1958 by Armstrong and co-creators. The term teichoic envelops an…
Q: What is the [CH3COO−]/[CH3COOH] ratio inan acetate buffer at pH 4.00?
A: A buffer is a mixture of weak acid/weak base and its conjugate base/acid. It is an aqueous solution.…
Q: You have 10 mg/ml ethidium bromide solution. If you add 5 µl of this to 50 ml of agarose gel…
A: Gel electrophoresis is a laboratory method for separating DNA molecules depending on their size and…
Q: Which fatty acid tail from the following diagram is saturated? Which one is unsaturated? Briefly…
A: the given struture is that of a triglyceride formed between the ester bond between glycerol molecule…
Q: Given a dipeptide Gly-Val, Gly: Pk,=2.34; pkK,=9.60 Val: Pk,=2.32; pK,=9.62 a. draw the protonic…
A: The peptides are biomolecules formed of more than one amino acid joined through an amide bond. The…
Q: Fatty acid with 30 carbons. How many ATPs?
A: Given: A fatty acid with 30 carbons ATPs are produced by complete oxidation of fatty acid.
Q: is the ph of 1.0 M with the concentration
A: The level of acidity is determined by the pH. It is used as an indicator to determine the…
Q: mixture of Alanine (pl 6.02), Glutamic Acid (pl 3.22), Glycine (pl 5.79), Lysine (pl 9.74) and…
A: As anion resin is positively charged, it attracts amino acids that have a negative charge. Proteins…
Q: What are the structuresof L-Cysteine from highly protonated to depronated form? What are the…
A: L- Cysteine It is a proteingenic amino acid, which contributes towards a multitude of functions in…
Q: The metabolic intermediate acetyl phosphate is an anhydride formed from acetic acid and phosphoric…
A: Anhydride is a type of chemical compound formed by the removal of water molecules from another…
Q: What product is formed when a solution of A and B is treated with mild base? This reaction is the…
A: Rosuvastatin is considered a medication used for cardiovascular disease in patients with abnormal…
Q: Calculate the isoelectric point of Aspartic acid
A: The isoelectric point of a solution is defined as the pH value at which amino acid or peptide is…
Q: What is cardiac glycoside? Discuss structure-activity relationship of cardiac glycosides.
A: The structure-activity relationship(SAR) of a molecule describes the relationship between the…
Q: s the pH of a 0.0001 M solution of hydrochloric
A: [H+]=0.0001=10-4 pH=-log[H]+ pH=4
Q: What is the predominant ionic form of ribose-5-phosphate at physiological pH? Would…
A: Ribose-5-phosphate is required by a cell for various functions like the synthesis of nucleotides and…
Q: Sketch a titration curve for aspartic acid, andindicate the pKa values of all titratable groups.…
A: To calculate the pH range when the conjugate acid-base pair +1 Asp and 0 Asp will act as a buffer,…
Q: Identify the charge states for aspartic acid (Asp), leucine (Leu) and Lysine (Lys) at pH 1, 7 and…
A: Amino acids have two functional group amino group and carboxylic group. Aspartic acid: pKa1…
Q: Draw the structure of two different aldohexoses that yield the followingaldaric acid when oxidized…
A: Aldohexose are 6 carbon containing compound which had an aldehyde group attached to it. Aldaric acid…
Q: Give the relative rates of reaction of the four carboxylic acid derivatives below with aqueous…
A: Introduction: Most reactive = b 2nd most reactive = a 3rd most reactive = c Least reactive = d
Q: What is the possible identity of the AA? a. Aspartic acid b. Lysine c. Alanine d. Proline 2.…
A: Amino acids are the building blocks of proteins. 20 standard amino acids occur in different…
Q: Consider a hexapeptide of the sequence thr asn glu trp lys gln. A researcher decided that this…
A: The hexapeptide contains 6 amino acids - thr, asn, glu, trp, lys, gln.
Q: 80mL of a 0.3M solution of hexapeptide Leu-His-Cys-Glu-Asn-Arg is adjusted to pH=pl. The solution is…
A: Proteins are unbranched polymers constructed from 20 standard α-amino acids. They have four levels…
Q: Η O ΝΗΣ NH NH ΝΗΣ HO NH
A: Cation exchange chromatography is a method of separation of biomolecules (proteins/peptides) based…
Q: What is the ratio of [A-]/[HA] in a solution with pH = 11.5? NH3 sh NH₂ sh + H+
A: Lysine is a basic amino acid with an amino group in its side chain. The pKa value of the lysine side…
Q: What are d ester linkages of fatty acids?
A: Introductions- Fatty acids are made up of long-chain or lipid with carboxylic acid as it is an…
Q: What is respiratory quotient? Calculate the respiratory quotient for each of the following…
A: Note: Since you have posted a question with multiple subparts, we will solve the first three…
Q: Determine the net charge of the predominant form of Asp at (c) pH 6.0, and (d) pH 11.0.
A: Introduction- Aspartic acid is an alpha non-essential amino acid that is occurring naturally in the…
Q: What is the net charge on cysteine in acidic solution at a pH below its isoelectric point. Charge:…
A: Amino acids are biomolecules with an amine and a carboxyl group. These molecules can exist as…
Q: Protein: SHAYNERSE Predict the products of the following reactions with the protein given, if there…
A: Given protein SHAYNERSE is…
Q: A 0.0284 M aqueous solution of lactic acid, HC3H5O3, a substance that accumulates in the blood and…
A: Ka represents the acid ionization constant, or the acid dissociation constant, which denotes the…
Q: what is the value of glycine pKa of nh3 group
A: Amino acids are organic compound having functional group carboxyl (-COOH) and amino (-NH2). pKa…
Nucleotides
It is an organic molecule made up of three basic components- a nitrogenous base, phosphate,and pentose sugar. The nucleotides are important for metabolic reactions andthe formation of DNA (deoxyribonucleic acid) and RNA (ribonucleic acid).
Nucleic Acids
Nucleic acids are essential biomolecules present in prokaryotic and eukaryotic cells and viruses. They carry the genetic information for the synthesis of proteins and cellular replication. The nucleic acids are of two types: deoxyribonucleic acid (DNA) and ribonucleic acid (RNA). The structure of all proteins and ultimately every biomolecule and cellular component is a product of information encoded in the sequence of nucleic acids. Parts of a DNA molecule containing the information needed to synthesize a protein or an RNA are genes. Nucleic acids can store and transmit genetic information from one generation to the next, fundamental to any life form.
Trending now
This is a popular solution!
Step by step
Solved in 3 steps with 4 images
- Decylic acid is a saturated fatty acid that occurs naturally in coconut oil and palm kernel oil. Calculate the net ATP yield when decylic acid undergoes complete B oxidation. The formula of decylic acid is shown below: (Given: The oxidation of one NADH yields 2.5 ATP; the oxidation of one FADH2 yields 1.5 ATP; and the oxidation of one acetyl CoA yields 10 ATP.) O 50 ATP O 52 ATP 66 ATP OH O 64 ATPIn the beta oxidation of linoleic acid, converting the 3, 5, 8 trienoyl CoA intermediate back to an expected intermediate for a beta oxidation substrate costs the equivalent of how many ATPs? (hint: look at the 'right side' of the figure for addressing problem 3 with linoleic acid)ATP Synthase is known to catalyze the synthesis of ATP with a ΔG°’ close to zero, and a Keq' close to. Why is the value of ΔG°’ different from the known value which is 30.5 kJ/mol (the energy for the reverse of ATP hydrolysis)? If the Keq' value is close to one, how is it ensured that the reaction is driven to the product side and more ATP is obtained?
- How many ATP molecules can be generated from one mol of 14CH3-COOH? (The conversion of acetate to acetyl-CoA requires the consumption of 2 ATP.)The formation of glutamine from glutamate and ammonium ions requires 14.2 kJ mol-1 of energy input. It is driven by the hydrolysis of ATP to ADP mediated by the enzyme glutamine synthetase. {a) Given that the change in Gibbs energy for the hydrolysis of ATP corresponds to ΔG = -31 kJ mol-1, under the conditions prevailing in a typical cell , can the hydrolysis drive the formation of glutamine? (b) What amount {in moles) of ATP must be hydrolysed to form 1 mol glutamine? (c) Suppose that the radius of a typical cell is 10 μm and that inside it 106 ATP molecules are hydrolysed each second. What is the power density of the cell in watts per cubic metre (1W = 1 Js- 1)? (d) A computer battery delivers about 15 Wand has a volume of 100 cm3 Which has the greater power density, the biological cell or the battery?Consider the following list of phosphorylated compounds with their free energy changes of phosphate hydrolysis: Glucose-1-phosphate (-5.0 kcal/mol), PEP (-14.8 kcal/mole), 1,3-bisphosphoglycerate (-11.8 kcal/mole) and Glucose-6-Phosphate (-3.3 kcal/mol). Given that the free energy change of ATP hydrolysis is -7.3 kcal/mole, which of these molecules be directly synthesized by the transfer of a phospho- group from ATP? 1,3-bisphosphoglycerate Glucose-6-phosphate All of those phosphorylated compounds. PEP Glucose-1-phosphate
- A direct measurement of the standard free-energy change associated with the hydrolysis of ATP is technically demanding because the minute amount of ATP remaining at equilibrium is difficult to measure accurately. The value of ΔG′° can be calculated indirectly, however, from theequilibrium constants of two other enzymatic reactions having less favorable equilibrium constants:Using this information for equilibrium constants determined at 25 °C, calculate the standard free energy of hydrolysis of ATP.While fatty acids longer than 20 carbons are rarely found in foods, lignoceric acid (24:0) is found in a variety of tree nuts. Answer the following based on the conversion of a molecule of lignoceric acid to 8-hydroxybutyrate. (a) What are the 8-oxidation products and how many ATP are required during activation for one molecule of lignoceric acid? (b) Given the following, how many molecules of 8-hydroxybutyrate can be produced? CoA 2 2 CoA NADH NAD+ H+ OH ẞ-hydroxybutyrate (c) Based on the total NADH and FADH2 available after converting lignoceric acid into 8-hydroxybutyrate, what is the maximum yield of ATP that can be produced in the liver? Don't forget to include any ATP required for activation steps.Myristoleic acid is a monounsaturated fatty acid found in small amounts in a variety of foods. Calculate the net ATP yield from the complete β-oxidation of myristoleic acid. The formula of myristoleic acid is shown below (it is assumed that the total ATP production is the same for both saturated and unsaturated fatty acids having the same carbon chain length). CH3-(CH2)3-CHCH-(CH2)7-COOH (Given: The oxidation of one NADH yields 2.5 ATP; the oxidation of one FADH2 yields 1.5 ATP; and the oxidation of one acetyl CoA yields 10 ATP. ) Group of answer choices a. 96 ATP b. 92 ATP c. 94 ATP d. 34 ATP e. 36 ATP
- In the hydrolysis of ATP to ADP and Pi, the equilibrium concentration of ATP is too small to be measured accurately. A better way of determining K’eq, and hence ΔG◦’ of this reaction, is to break it up into two steps whose values of ΔG◦’ can be accurately determined. This has been done using the following pair of reactions (the first being catalyzed by glutamine synthetase): (1) ATP + glutamate + NH3 ⇌ ADP + Pi + glutamine + H+ ΔG1◦’= -16.3 kJ/mol (2) glutamate + NH3 ⇌ glutamine + H2O + H+ ΔG2◦’= 14.2 kJ/mol What is the ΔG◦’ of ATP hydrolysis according to these data and is the overall reaction spontaneous? What is the value of the equilibrium constant for the overall reaction at 25.0 °C. If the concentration of ATP at equilibrium is 20.0 mM and the concentration of ADP at equilibrium is 50 nM. What is the concentration the phosphate group (in mM) at equilibrium?The ATP hydrolysis reaction (shown below) has a AG of -31 kJ mol-1. NH2 NH2 Do you predict that AS is positive or negative for this reaction. Explain in one sentence. а. .N H20 -OCH2 OCH2 Energy Phosphate ion ÓH ÓH Adenosine triphosphate (ATP) Adenosine diphosphate (ADP) b. How does the hydrophobic effect contribute to the AS you predicted in part a. Make sure to discuss the ordering of water molecules in your answer. Include a minimum of 3 sentances in your explaination.Phosphocreatine (G0ʹ = -43.1 kJ/mol) has a higher phosphoryl group transfer potential than ATP (G0ʹ = -30.5 kJ/mol). However, under certain physiological conditions, phosphoryl group is transferred from ATP to creatine. Explain this discrepancy. Many biochemical conversions are carried out via multi-step pathways although similar conversions can be done in an organic chemistry lab in fewer steps. Explain why energetically it is reasonable to use multiple steps in biochemical conversions. What are isozymes? Humans contain several isozymes of hexokinase. Why does the body need several isozymes of hexokinase? 1,3-bisphosphoglycerate is used to produce ATP. Which of the two phosphates of 1,3- bisphosphoglycerate is transferred to ADP to make ATP. Explain why it is this specific phosphate and not the other one. Triose phosphate isomerase is a diffusion-controlled enzyme. What reaction is catalyzed by this enzyme (structures of molecules not needed)? Explain why…