Using the thermodynamic information in the ALEKS Data tab, calculate the standard reaction free energy of the following chemical reaction: 2NOC1 (g) → 2NO (g) + Cl₂(g) Round your answer to zero decimal places. kJ 0 ☐x10 X S ?

Another step in the metabolism of glucose, which occurs after the formation of glucose6-phosphate, is the conversion of fructose6-phosphate to fructose1,6-bisphosphate(bis meanstwo): Fructose6-phosphate(aq) + H2PO4(aq) fructose l,6-bisphosphate(aq) + H2O() + H+(aq) (a) This reaction has a Gibbs free energy change of +16.7 kJ/mol of fructose6-phosphate. Is it endergonic or exergonic? (b) Write the equation for the formation of 1 mol ADP fromATR for which rG = 30.5 kJ/mol. (c) Couple these two reactions to get an exergonic process;write its overall chemical equation, and calculate theGibbs free energy change.

A piece of lead of mass 121.6 g was heated by an electrical coil. From the resistance of the coil, the current, and the Time the current flowed, it was calculated that 235 J of heat was added to the lead. The temperature of the lead rose from 20.4C to 35.5C. What is the specific heat of the lead?

Using values of fH and S, calculate the standard molar free energy of formation, fG, for each of the following: (a) Ca(OH)2(s) (b) Cl(g) (c) Na2CO3(s) Compare your calculated values of fG with those listed in Appendix L. Which of these formation reactions are predicted to be product-favored at equilibrium at 25 C?

Determine the standard Gibbs free energy change, rG, for the reactions of liquid methanol, of CO(g), and ofethyne, C2H2(g), with oxygen gas to form gaseous carbondioxide and (if hydrogen is present) liquid water at298 K. Use your calculations to decide which of thesesubstances are kinetically stable and which are thermodynamically stable: CH3OH(), CO(g), C2H9(g), CO2(g),H2O().

The formation of aluminum oxide from its elements is highly exothermic. If 2.70 g Al metal is burned in pure O2 to give A12O3, calculate how much thermal energy is evolved in the process (at constant pressure).

From the data given in Appendix I, determine the standard enthalpy change and the standard free energy change for each of the following reactions: (a) BF3(g)+3H2O(l)B(OH)3(s)+3HF(g) (b) BCl3(g)+3H2O(l)B(OH)3+3HCl(g) (c) B2H6(g)+6H2O(l)2B(OH)3(s)+6H2(g)