The chlorination of methane occurs in a number of steps that results in the The overall reaction is What is the partial pressure of CH₂7 2CH₂(g) + 3Cl₂(g)-2CH,Ckp+ 2HCX(g) + 2CT (g) Suppose that a chemist combines 213 ml, of methane and 987 ml. of chlorine at STP is a 2.00 L flask. The flask is then allowed to stand at 298 K. If the reaction reaches 75.6% completion, what is the sotal pressure in the flask PCK = What is the partial pressure of Cl₂? Per PC = What is the partial pressure of CH,CI? POHO= Ph What is the partial pressure of HCI? What is the partial pressure of CI"? omethane and hydrogen chloride atm atm atm

Q: 100 1312313USHNEL 50 4000 a f www OH 3000 Which of the following molecules could make the above IR…

A: The IR spectrum of the solid sample in the image shows the presence of the following functional…

Q: Specify a synthetic scheme that would produce the compound shown above in the fewest steps possible.…

A:

Q: Complete and balance the following half-reaction in basic solution. Be sure to include the proper…

A: A redox reaction is balanced by balancing the mass and charge. In a basic medium, the reaction is…

Q: What type(s) of intermolecular forces are expected between CH3CH₂COOCH₂CH3 molecules? HH Н Indicate…

A:

Q: The dissociation equilibrium constants for the protonated form of alanine (a diprotic amino acid…

A: Given that:Volume of alanine solution =  Volume of NaOH added = 100.00 mL​Concentration of alanine =…

Q: The mass of 6.50 mol of potassium sulfate is

A: mass of potassium sulfate(K2SO4)=?molar mass of potassium sulfate(K2SO4)=174.3g/molmoles of…

Q: Structure at low pH (A) H3N. Structure at neutral pH (B) 3. Answer the following questions regarding…

A: When pH > pKa of a group then that group is deprotonated. When pH < pKa of a group then that…

Q: Identify the cumulated diene. 3-methyl-1,5-heptadiene 4-methyl-1,4-heptadiene…

A: The term 'diene' represents the organic compound containing two double bonds. The alkene that…

Q: (17,18-3,3) Select the most acidic hydrogen in the molecule below.

A: Answer:More stable the conjugate after the lose of hydrogen, more acidic that hydrogen will be. So,…

Q: When the concentration of a reactant is doubled there can be several outcomes of the rate. When the…

A: Answer :--When the concentration of a reactant is doubled and the rate is multiplied by 2 then the…

Q: Name the following groups. CH3CH₂- CH3CH₂CH₂- CH3CH₂CH- T CH3 group group group

A:

Q: Provide the major organic product(s) of the reaction shown below. NO₂ .CI NaNH,

A: Nucleophilic aromatic substitution involves the attack of a nucleophile on an aromatic ring and…

Q: Carry out the following operations and express the answers with the appropriate number of…

A: The given example are based on the four fundamental operations of arithmetic addition, subtraction,…

Q: In the following scenarios, determine whether the reaction will proceed forward, reverse, or if…

A:

Q: how are the atoms in Hg2P2O7 and Na2S2O3 assigned oxidation numbers.

A: Oxidation number :It is the total number or count of electrons which may take part in bond formation…

Q: L N Br HNO3/H₂SO4 NaOEt M N (i) Give the structure of M and a mechanism for its formation. the the…

A: To draw the product and mechanism of the reaction of 2-bromoquinoline with HNO3/H2SO4 and NaOEt.

Q: What is the IUPAC name for the following alkane? ball & stick V Submit Answer C - + labels Retry…

A:

Q: To make a 300mL of 3% NaCl, weigh ______ grams of NaCl, place in a graduated cylinder, and add water…

A: Molarity = number of moles of solute per litre of solution. Percent by volume   = mL of solute / 100…

Q: 1. What is the final concentration of a solution made by mixing 20.0 mL of 1.44 M HCl with water to…

A: Initial HCl solutionConcentration of HCl solution (M1) = 1.44 MVolume of HCl solution (V1) = 20.0…

Q: Using condensed structural formulas and showing all products with any catalysts, draw the remainder…

A: To draw the remainder of the equation for the hydrogenation of the following triacylglycerol:

Q: 1. Determine the pH of a 0.0032 M KOH solution. Show your work. 2. Write the formula for the…

A: Given,The molarity of KOH = 0.0032 M The conjugate acid of H2PO3- is: The conjugate base of H2CO3…

Q: what patterns do you see in the flame data that support your idea that metals cause flame colours…

A: When alkali metals and their salts are exposed to a Bunsen flame, they produce a distinct color. The…

Q: How would you classify this monosaccharide? CHO H HO- но-н F H- -OH -H -OH CH2OH Select one: a.…

A:

Q: 6) Draw the product of the following reaction: & bom F₂C (1 eq)

A: Given compounds are substrate -  ketone and reagent - peracid.Generally ketones in presence of…

Q: 1. Fill in the table with the missing information. Name Abbreviation One Letter Symbol Name…

A: Amino acids are groups of biomolecules.They are the basic building blocks of proteins. They are…

Q: A sample from a mine's tailings pond contains Pb2, Ag+, Mg2+, and Na+ cations.What ionic compounds…

A: To achieve the separation of Pb2+, Ag+, Mg2+, and Na+ cations within a sample…

Q: Will the following reaction occur? CHÍNH, Multiple Choice O O Yes No Я понень NHCH,

A: Acid anhydrides on reaction with primary amines forms amides. This reaction is known as the…

Q: Calculate the pH at the equivalence point for the titration of 0.110 M methylamine (CH3NH₂) with…

A: Given,Molarity of methyl amine ( CH3NH2) = 0.110 MMolarity of HCl = 0.110 MKb of CH3NH2 = 5.0 x 10-4…

Q: Calculate the pH for the following reaction: NaOH   +   HCO2H   --->   H2O   +   HCO2-   +   Na+…

A: The Balanced chemical equation for the reaction between HCO2H and NaOH is                      HCO2H…

Q: 4A.7 (a) Calculate the heat that must be supplied to a copper kettle of mass 400.0 g containing…

A: When no transition of phase takes place, the heat supplied to a body leads to a rise in the…

Q: Give the structure of the Aldol condensation product when acetone reacts with itself.

A: To determine the structure of Aldol condensation product when acetone reacts with itself.Aldol…

Q: Question 10. Use the bond energies provided to estimate the mass of O2(g) required to produce 1,035…

A: Reaction :

Q: Identify five mistakes in the following hypothetical two component phase diagram with suitable…

A: A phase diagram is a graphical representation of a substance's physical state under various…

Q: The atomic molar mass of some elements, as shown in the periodic table, is as follows. Atomic molar…

A: moles of calcium = 3.00 molAtomic molar mass of calcium = 40.08 g/molmass of calcium = ?

Q: + Co->-Nit_Co+3 Acidic Salution -Nita+

A:

Q: A? spe b) Using m/z values for species A and B, calculate the molecular weight of H4 [do not use any…

A: Given:The charge states of species A =703.3Foe species B=803.6For A isotopic peaks are  apart.ESI is…

Q: Starting with acetylene, how can you synthesize the following? НС - он 0000 b C d 1) add NaH and…

A: The given reaction are example of nucleophilic addition reaction and last step is a catalytic…

Q: w would you synthesize the following compounds from butanoic acid using reagents from the table? e…

A: The following molecules are synthesized from butanoic acid by means of the above reagents.The above…

Q: Provide the major organic product(s) of the reaction shown below. NO₂ .CI NaNH,

A: The reaction between 1,2-Dichloro-4-nitrobenzene (C6H3Cl2NO2) and NaNH2 (sodium amide) is a…

Q: د هری R R 120° но. CN RTR 109.5 37

A: A detailed explanation of this question is given below

Q: Identify the class of lipid of the following molecule: O || CH3-(CH2)18-C-O-(CH2)19-CH3 steroid…

A:

Q: 100 50 D 4000 a f 3000 OH Which of the following molecules could make the above IR spectrum? H₂N b…

A: IR spectra match with compound considering the functional group present in the compound.

Q: What are the oxidation states of O, C and N in the cyanate ion, [OCN] ? Carbon is the central atom.…

A: Answer:Formal charge that can be considered present on the atom in a chemical specie is called as…

Q: C. D. тео So list ног A 1. Na OE7 2. 3. HO, A

A: First reaction is an example of Diels-Alder (4n+2π)  reaction.It is a concerted reaction.…

Q: Consider the reaction scheme below. e (i) H3COCHN CO₂Et A H₂N OH EtO OEt B C6H₁1 NO₂ base Ha…

A: To identify the reagent(s) and conditions A and the intermediate B in the reaction mixture.

Q: The triple-alpha process is a nuclear fusion process in which three helium-4 nuclei form carbon-12.…

A:

Q: A voltaic cell is constructed in which the cathode is a standard hydrogen electrode and the anode is…

A: GivenThe cell potential Ecell is 0.193 V Pressure of H2 = 1 atmThe electrochemical cell reaction in…

Q: 4. Osmolarity and Osmolality Which of the following pairs of solutions have equivalent…

A: Electrolytes are ionized to produce number of ions. osmolarity = number of ions produced multiplied…

Q: 4. Balance the following equations by the redox method, include all the steps of the procedure.…

A: Step 1. Write down the -29c1-4ab9-867c-62d2d5ac22a3-0-0 style='text-decoration: underline; position:…

Q: 1. A sample of magnesium phosphate contains x moles of Mg3(PO4)2. Express each of the following…

A: The detailed explanation of the given question is below

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.