The acetylacetone ion forms very stable complexes with many metallic ions. It acts as a bidentate ligand, coordi- nating to the metal at two adjacent positions. Suppose that one of the CH3 groups of the ligand is replaced by a CF; group, as shown here: н Trifluoromethyl acetylacetonate CF-Ç (ffac) C-CH3 :Ö: :0: Sketch all possible isomers for the complex with three tfac ligands on cobalt(III). (You can use the symbol to repre- sent the ligand.)

The acetylacetone ion forms very stable complexes with many metallic ions. It acts as a bidentate ligand, coordi- nating to the metal at two adjacent positions. Suppose that one of the CH3 groups of the ligand is replaced by a CF; group, as shown here: н Trifluoromethyl acetylacetonate CF-Ç (ffac) C-CH3 :Ö: :0: Sketch all possible isomers for the complex with three tfac ligands on cobalt(III). (You can use the symbol to repre- sent the ligand.)

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section: Chapter Questions

Problem 121QRT: The glycinate ion (gly) is H2NCH2CO2. It can act as a ligand coordinating through the nitrogen and...

See similar textbooks

Similar questions

Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?