Question 8 Consider the reaction N204(g) + Cl2(g) → 2 NOCI(g) + O2(g) Using the following thermochemical equations, calculate the enthalpy change for the reaction above. 2 NOCI(g) → 2 NO(g) + Cl2(g) 2 NO(g) + O2(g) → 2 NO2(g) AH° = +75.56 kJ/mol AH = -113.05 kJ/mol AH°= -58.03 kJ/mol 2 NO2(g) → N204(g) Edit View Insert Format Tools Table 12pt Paragraph BIVA L

Question 8 Consider the reaction N204(g) + Cl2(g) → 2 NOCI(g) + O2(g) Using the following thermochemical equations, calculate the enthalpy change for the reaction above. 2 NOCI(g) → 2 NO(g) + Cl2(g) 2 NO(g) + O2(g) → 2 NO2(g) AH° = +75.56 kJ/mol AH = -113.05 kJ/mol AH°= -58.03 kJ/mol 2 NO2(g) → N204(g) Edit View Insert Format Tools Table 12pt Paragraph BIVA L

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter8: Thermochemistry

Section: Chapter Questions

Problem 36QAP: Given the following thermochemical equations: 4B(s)+3O2(g)2B2O3(s)H=2543.8kJ H2(g)+12...

See similar textbooks

Similar questions

Given the following thermochemical equations: 4B(s)+3O2(g)2B2O3(s)H=2543.8kJ H2(g)+12 O2(g)H2O(g)H=241.8kJ B2H6(s)+3O2B2O3(s)+3H2O(g)H=2032.9kJ Calculate H for the decomposition of B2H6 into its elements.
Use Appendix L to find the standard enthalpies of formation of oxygen atoms, oxygen molecules (O2), and ozone (O3). What is the standard state of oxygen? Is the formation of oxygen atoms from O2 exothermic? What is the enthalpy change for the formation of 1 mol of O3 from O2?
The process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?
Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.
The enthalpy change when 1 mol methane (CH4) is burned is 890 kJ. It takes 44.0 kJ to vaporize 1 mol water. What mass of methane must be burned to provide the heat needed to vaporize 1.00 g water?
Calculate H for the reaction N2H4(l)+O2(g)N2(g)+2H2O(l) given the following data: Equation H(KJ) 2NH3(g)+3N2O(g)4N2(g)+3H2O(l) 1010 N2O(g)+3H2(g)N2H4(l)+H2O(l) 317 2NH3(g)+12O2(g)N2H4(l)+H2O(l) 143 H2(g)+12O2(g)H2O(l) 286
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)
The enthalpy changes for the following reactions can be measured: CH4(g) + 2 O2(g) CO2(g) + 2 H2O(g) rH = 802.4 kJ/mol-rxn CH3OH(g) + 32 O2(g) CO2(g) + 2 H2O(g) rH = 676 kJ/mol-rxn (a) Use these values and Hesss law to determine the enthalpy change for the reaction CH4(g) + O2(g) CH3OH(g) (b) Draw an energy level diagram that shows the relationship between the energy quantities involved in this problem.
A substance, X, has the following properties: Specific Heat Capacities Hvap 20.kj/mol C(s) 3.0j/gC Hfus 5.0kj/mol C(l) 2.5j/gC bp 75C C(g) 2.5j/gC mp 15C
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
9.38 The energy densities of various types of coal are listed below: Anthracite 35 kJ/g Subbituminous 31 kJ/g Bituminous 28 kJ/g Lignite 26 kJ/g An unknown sample of one of these coals is burned in an apparatus with a calorimeter constant of 1.3 kJ/°C. When a 0.367-g sample is used, the temperature change is 8.75°C. Which type of coal is the sample?
Draw a diagram like Figure 2.11 that illustrates the change in enthalpy for the chemical reaction C s 2H2 g CH4 g Which is exothermic by 74.8 kJ/mol.