Predict the sign of AS° and then calculateAS° for each of the following reactions:2H,S(g) + SO,(g) →3S,NegativeAS° =-186 J/Kа.Prhombic (S) + 2H,0 (g)%3Db.Positive2S0, (g)→ 2S0,(g) + 0, (g)AS° = 187 J/KC.Hard to predictsince An = 0AS° = 138 J/KFe,0, (s)+ 3H,(g) → 2Fe(s) +3H,0(g)

a) The given reaction is: 2H2S(g)+SO2(g)→3Srhombic(s)+2H2O(g) ∆S˚ of the reaction is given by:…

Predict the sign of AS° and then calculate AS ° for each of the following reactions: 2H,S(g) + SO,(g)→3Sthombie (8) + 2H,0 (g) Negative а. AS° =-186 J/K rhombic b. Positive 2S0, (g)→ 2SO,(g) +0,(g) AS° = 187 J/K С. Hard to predict Fe,0,(s) + 3H, (g)→2FE(s) +3H,O(g) since Δη 0 AS° = 138 J/K

Predict the sign of AS° and then calculate AS ° for each of the following reactions: 2H,S(g) + SO,(g)→3Sthombie (8) + 2H,0 (g) Negative а. AS° =-186 J/K rhombic b. Positive 2S0, (g)→ 2SO,(g) +0,(g) AS° = 187 J/K С. Hard to predict Fe,0,(s) + 3H, (g)→2FE(s) +3H,O(g) since Δη 0 AS° = 138 J/K

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter10: Entropy And The Second Law Of Thermodynamics

Section: Chapter Questions

Problem 3CO

See similar textbooks

Similar questions

For the reaction at 298 K, 2NO2(g)N2O4(g) the values of H and S are 58.03 kJ and 176.6 J/K, respectively. What is the value of G at 298 K? Assuming that H and S do not depend on temperature, at what temperature is G = 0? Is G negative above or below this temperature?
Nickel metal reacts with carbon monoxide to form tetra-carbonyl nickel, Ni(CO)4: Ni(s)+4CO(g)Ni(CO)4(g) This reaction is exploited in the Mond process in order to separate pure nickel from other metals. The reaction above separates nickel from impurities by dissolving it into the gas phase. Conditions are then changed so that the reaction runs in the opposite direction to recover the purified metal. (a) Predict the sign of S for the reaction as written above. (b) Use tabulated thermodynamic data to calculate H, S , and G for the reaction. (c) Find the range of temperatures at which this reaction is spontaneous in the forward direction.
How is the sign of q, heat, defined? How does it relate to the total energy of the system?
The reaction shown below is involved in the refining of iron. (The table that follows provides all of the thermodynamic data you should need for this problem.) 2Fe2O3(s)+3C(s,graphite)4Fe(s)+3CO2(g) (a) Find H for the reaction. (b) S for the reaction above is 557.98 J/K. Find S° for Fe2O3(s). (c) Calculate G for the reaction at the standard temperature of 298 K. (There are two ways that you could do this.) (d) At what temperatures would this reaction be spontaneous? Compound Hf (kJ mol-1) S° (kJ mol-1) Gf (J mol-1 K-1) Fe2O3(s) -824.2 ? -742.2 C(s, graphite) 0 5.740 0 Fe(s) 0 27.3 0 CO2(g) -393.5 213.6 -394.4.83
Given the following data 2O3(g) 3O2(g)H = 427 kJ O2(g) 2O(g)H = 495 kJ NO(g) + O3(g) NO2(g) + O2(g)H = 199 kJ Calculate H for the reaction NO(g) + O(g) NO2(g)
For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)
For the reaction TiCl2(s) + Cl2(g) TiCl4(), rG = 272.8 kj/mol-txn. Using this value and other data available in Appendix L, calculate the value of fG for TiCl2(s).
Define the standard enthalpy of formation. What are standard states for elements and for compounds? Using Hess's law, illustrate why the formula Hreaction=npHf(products)nfHf(reactants) works to calculate H for a reaction.
Calculate H and G for the following reactions at 25C, using thermodynamic data from Appendix C; interpret the signs of H and G. a 2PbO(s)+N2(g)2Pb(s)+2NO(g)\ b CS2(l)+2H2O(l)CO2(g)+2H2S(g)
Two crystalline forms of white phosphorus are known. Both forms contain P4 molecules, but the molecules are packed together in different ways. The form is always obtained when the liquid freezes. However, below 76.9C, the form spontaneously converts to the form: P4(s,)P4(s,) a. Predict the signs of H and S for this process. b. Predict which form of phosphorus has the more ordered crystalline structure (has the smaller positional probability).