Nitric oxide (NO) can be formed from nitrogen, hydrogen and oxygen in two steps. In the first step, nitrogen and hydrogen react to form ammonia: N,(9) + 3 H,(9) → 2 NH3(9) AH=-92. kJ In the second step, ammonia and oxygen react to form nitric oxide and water: 4 NH3(g) + 50,(9) 4 NO(g) + 6 H,O(g) AH=-905. kJ Calculate the net change in enthalpy for the formation of one mole of nitric oxide from nitrogen, hydrogen and oxygen from these reactions. Round your answer to the nearest kJ.

Nitric oxide (NO) can be formed from nitrogen, hydrogen and oxygen in two steps. In the first step, nitrogen and hydrogen react to form ammonia: N,(9) + 3 H,(9) → 2 NH3(9) AH=-92. kJ In the second step, ammonia and oxygen react to form nitric oxide and water: 4 NH3(g) + 50,(9) 4 NO(g) + 6 H,O(g) AH=-905. kJ Calculate the net change in enthalpy for the formation of one mole of nitric oxide from nitrogen, hydrogen and oxygen from these reactions. Round your answer to the nearest kJ.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 108E: The sugar sucrose, which is present in many fruits and vegetables, reacts in the presence of certain...

See similar textbooks

Similar questions

4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
Silicon is produced for the chemical and electronics industries by the following reactions. Give the balanced equation for each reaction. a. SiO2(s)+C(s)arefurnaceElectricSi(s)+CO(g) b. Liquid silicon tetrachloride is reacted with very pure solid magnesium, producing solid silicon and solid magnesium chloride. c. Na2SiF6(s) + Na(s) Si(s) + NaF(s)
The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.
Propane, C3H8, is the fuel of choice in a gas barbecue. When burning, the balanced equation is C3H8+5O23CO2+4H2O a What is the limiting reactant in cooking with a gas grill? b If the grill will not light and you know that you have an ample flow of propane to the burner, what is the limiting reactant? c When using a gas grill you can sometimes turn the gas up to the point at which the flame becomes yellow and smokey. In terms of the chemical reaction, what is happening?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Chalky, white crystals in mineral collections are often labeled borax, which has the molecular formula Na2B4O7 10H2O, when actually they are partially dehydrated samples with the molecular formula Na2B4O7 5H2O, which is more stable under the storage conditions. Real crystals of borax are colorless and transparent. (a) Calculate the percent mass that the mineral has lost when it partially dehydrates. (b) Is the percent boron by mass the same in both compounds?
Methane (CH4) is the main component of marsh gas. Heating methane in the presence of sulfur produces carbon disulfide and hydrogen sulfide as the only products. a. Write the balanced chemical equation for the reaction of methane and sulfur. b. Calculate the theoretical yield of carbon disulfide when 120. g of methane is reacted with an equal mass of sulfur.
How is the addition of heat symbolized in a chemical equation? The addition of light energy?