lon selective electrode (ISE) is an electrochemical device for the selective determination of the concentration/activity of an ion based on the principle of potentiometry. Typical examples include pH electrodes and the fluoride ISE. To use an ISE, the potential of the ISE is first measured with a range of solutions containing different concentrations of the analyte. Then, a calibration curve is constructed by plotting the potential versus log₁0[ion]. For an ideal Ca²+ ion selective electrode, which of the following slopes is the one that you would expect? (T = 25 °C) Select one: O a. -30 mV/dec O b. 30 mV/dec O c. 59 mV/dec O d. -59 mV/dec

lon selective electrode (ISE) is an electrochemical device for the selective determination of the concentration/activity of an ion based on the principle of potentiometry. Typical examples include pH electrodes and the fluoride ISE. To use an ISE, the potential of the ISE is first measured with a range of solutions containing different concentrations of the analyte. Then, a calibration curve is constructed by plotting the potential versus log₁0[ion]. For an ideal Ca²+ ion selective electrode, which of the following slopes is the one that you would expect? (T = 25 °C) Select one: O a. -30 mV/dec O b. 30 mV/dec O c. 59 mV/dec O d. -59 mV/dec

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 147CP: The measurement of pH using a glass electrode obeys the Nernst equation. The typical response of a...

See similar textbooks

Similar questions

For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
The measurement of pH using a glass electrode obeys the Nernst equation. The typical response of a pH meter at 25 00C is given by the equation where contains the potential of the reference electrode and all other potentials that arise in the cell that are not related to the hydrogen ion concentration. Assume that = 0.250 V and that a. What is the uncertainty in the values of pH and [H+] if the uncertainty in the measured potential is 1 m V ( 0.001 V)? b. To what precision must the potential be measured for the uncertainty in pH to be 0.02 pH unit?
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
A 0.0712-g sample of a purified organic acid was dissolved in an alcohol-water mixture and titrated with coulometrically generated hydroxide ions. With a current of 0.0392 A, 241 s was required to reach aphenolphthalein end point. Calculate the equivalent mass of the acid.
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
The cell potential of the following cell at 25C is 0.480 V. ZnZn2+(1M)H+(testsolution)H2(1atm)Pt What is the pH of the test solution?
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Calculate the standard cell potential of the following cell at 25C. Cr(s)Cr3(aq)Hg22(aq)Hg(l)