101 Chem101X D The Periodic Table Song (2 XG How many moles of nitroXG what is the molar masPiazzaA app.101edu.coAppsMyUSU O Outlook CanvasLabflow OneNote 101 Chem101TophatQuestion 20 of 24If 2.30 moles of H, and 1.55 moles of O, react how many moles of H,Ocan be produced in the reaction below?2 H,(g) + O,(g) → 2 H,O(g)escF2F3ES

Answered: Image /qna-images/answer/4f04d006-8849-40b8-a160-9b7aa8f59a6c.jpg

Answered: If 2.30 moles of H, and 1.55 moles of…

If 2.30 moles of H, and 1.55 moles of O, react how many moles of H,O can be produced in the reaction below? 2 H,(g) + O,(g) → 2 H,O(g)

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter11: Stoichiometry

Section: Chapter Questions

Problem 9STP

See similar textbooks

Related questions

Q: 2SO2(g) + O2(g) 2S03(g) For the reaction above, if 4.0 moles of SO, and 6.0 moles of O2 gas react in…

Q: A container holds 15.0 g of P₄O₆ and 6.00 g of O₂. The following reaction occurs: P₄O₆ + 2O₂ →…

A: In a chemical reaction, the theoretical yield of the product is known according to the chemical…

Q: According to the balanced reaction below, calculate the moles of NH, gas that form when 4.2 |mol of…

Q: Nitrogen monoxlde reacts with oxygen according to the following reaction: 2NO(g) +02() 2NO2(g) If 10…

A: Given reaction is 2NO + O2 —> 2NO2 10 moles of NO and 4 moles of O2 reacts. Moles of NO2 produced…

Q: Given the following reaction: CH4 + 202 → CO2 + 2 H2O How many moles of CO2 will be produced from…

A: Number of moles is calculated by dividing the given mass with molecular mass.

Q: If a reaction vessel initially contains 7 mol of S and 9 mol of O2, how many moles of S will be in…

A: The balanced reaction between sulfur and oxygen can be given as

Q: According to the balanced reaction below, calculate the moles of NO, gas that form when 5.20 x 10-|…

A: 2 N2O5 == 4 NO2 + O2 2 moles of N2O5 gives 4 moles of NO2

Q: If 2.60 moles of H2 and 1.55 moles of O2 react how many moles of H2O can be produced in the reaction…

A: The chemical equation for a reaction between H2 and O2 gas is as follow…

Q: If 2.65 moles of H2 and 1.55 moles of O2 react how many moles of H20 can be produced in the reaction…

A: SOLUTION: Step 1: In the above given reaction, 2 moles of H2 produced 2 moles of H2O which implies…

Q: A chemist uses 5.29 g of carbon (C) and performs the following reaction: Na2SO4 + 4C ---> Na2S+4CO…

Q: Aluminium reacts with oxygen to form aluminium oxide in a synthesis reaction described by the…

A: The reaction taking place is given as, => Al + O2 -----> Al2O3

Q: A container holds 22.0 g of P₄O₆ and 6.00 g of O₂. The following reaction occurs: P₄O₆ + 2O₂ → P₄O₁₀…

A: Given data,Mass of P4O6=22gMass of O2=6gMass of P4O10(actual yield)=17.5g

Q: 5.) Calculate the number of moles of water produced by the reaction of 3.Z hydroxide. _Ca(OH),…

Q: Consider the following unbalanced chemical equation: C+ O2 -> CO2. Given 2 moles of carbon, how…

A: The reaction is written below. C + O2 → CO2 According to the reaction, 1 mole of C requires 1 mole…

Q: According to the balanced reaction below, calculate the quantity of moles of NO, gas that forms when…

A: Given, the chemical reaction as follows,2N2O4(g)→4NO2(g)+O2(g)Number of moles for reaction…

Q: Ammonia (NH,) gas and oxygen (0,) gas react to form nitrogen (N,) gas and water (H,0) vapor. Suppose…

A: The reaction between the chemical compound can be determined by the limiting reagent in the…

Q: You react 100.0 g of O2 and 50.0 g of H2 in a container and produce water. 2H2 + O2 → 2H2O How…

A: Limiting reactant :- reactant which is present in less amount than required as per balanced chemical…

Q: 1. Use the following equation to solve the problem below: 3 SiO, + 4 Al → 3 Si + 2 Al,O, a. If 6.0…

Q: If 2.00 moles of H2 and 1.55 moles of O2 react how many moles of H20 can be produced in the reaction…

A: In this question, 2.00 moles of H2 and 1.55 moles of O2 react, then how many moles of H2O can be…

Q: Benzene (C6H6) burns in air according to the following equation shown below. How many moles of O2…

A: The given equation is

Q: CH4 +2O2–>CO2+2H2O If 76g of H2O is produced what mass of O2 was required?

A: Answer - According to the question - Given reaction is - CH4 +2O2–>CO2+2H2O Given value - Mass of…

Q: If 2.60 moles of H₂ and 1.55 moles of O₂ react how many moles of H₂O can be produced in the reaction…

Q: If 5.00 moles of hydrogen react with 7.00 moles of nitrogen, how many moles of ammonia can form?…

A: One mole of nitrogen gas reacts with three moles of hydrogen gas to form two moles of ammonia gas.…

Q: If 2.45 moles of H₂ and 1.55 moles of O₂ react how many moles of H₂O can be produced in the reaction…

A: The balanced chemical equation for the reaction between H2 and O2 is as follows:…

Q: The decomposition of solid aluminum oxide results in the production of solid aluminum and molecular…

Q: In the acetylene torch, acetylene gas (C2H2) burns in oxygen to produce carbon dioxide and water.…

A: Acetylene gas (C2H2) reacts with oxygen to produce carbon dioxide and water, the equation for the…

Q: If

A: The reaction of the process is : 2 NO + O2 ---------------> 2 NO2 Now the moles of NO = 33.6/30 =…

Q: According to the balanced reaction below, calculate the moles of NO₂ gas that form when 5.20 × 10⁻³…

A: stoichiometry for N2O5=2 Stoichiometry for NO2=4 stoichiometry for O2=1 Apply the mole-mole analysis…

Q: How many atoms of Al are needed to react with 34.5 grams of O2 gas? 4Al + 3O2 --> 2Al2O3

A: Given that, Mass of O2 = 34.5 gms Molecular mass = 32 gm/mol Number of moles=Given massMolecular…

Q: If 2.80 moles of H2 and 1.55 moles of O2 react how many moles of H20 can be produced in the reaction…

A: According to the given chemical reaction, each mole of O2 (g) completely reacts with 2 mol of H2…

Q: Methanol CH3OH, combusts in air to produce carbon dioxide and water vapor according to the following…

Q: If 2.45 moles of H2 and 1.55 moles of O2 react how many moles of H20 can be produced in the reaction…

A: The reaction given is => 2 H2 (g) + O2 (g) ---------> 2 H2O (g) Given : Moles of H2 taken =…

Q: If 100.0 molecules of H2 and 40.0 molecules of O2 react, how many molecules of H20 can be produced…

A: The given reaction is as follows. 2H2+02→2H20 From this balanced equation it is clear that we…

Q: Nitrogen monoxide reacts with oxygen according to the following reaction: 2NO(g) + O2 (g) --->…

A: The chemical equation is as follows:

Q: If 2.80 moles of H, and 1.55 moles of O2 react how many moles of H20 can be produced in the reaction…

A: The balanced chemical reaction is, 2H2 + O2 ---------> 2H2O So from the balanced chemical…

Q: In this reaction: Mg (s) + 2 (S) → Mgl2 (s) If 3.44 moles of Mg react with 3.56 moles of 2, and 1.76…

A: Interpretation: From the given information, percent yield of the reaction is to be determined.

Q: A 0.777g sample of an organic 5) compound is burned completely. It produces 1.42g CO2 and 0.388g…

A: Given: Weight of sample = 0.777 g Mass of CO2 produced = 1.42 g Mass of H2O produced = 0.388 g…

Q: Enter your answer in scientific notation. Be sure to answer all parts. The burning of acetylene…

A: Given mass of acetylene = 19.0 kg Balanced equation C2H2(g) + 5/2 O2(g) → 2CO2(g) + H2O(g) by…

Q: Diatomic N2 can react with diatomic H2 to form ammonia (Haber Process). The balanced chemical…

Q: Question 4 of 17 O Attempt 1 Consider the combustion reaction for octane (C,H3), which is a primary…

Q: According to the balanced reaction below, calculate the quantity of moles of NH, gas that form when…

A: Given :- Balanced equation : 3 N2H4(l) → 4 NH3(g) + N2(g) Number of moles of N2H4 reacts = 4.20…

Q: Consider the gaseous reaction at 347 C N2 + 3H2 ---> 2NH3 if 2.00 mole of N2 and 3.00…

Q: If 2.85 moles of H₂ and 1.55 moles of O₂ react how many moles of H₂O can be produced in the reaction…

A: The balance chemical equation : 2H2(g) + O2(g) ----> 2H2O(g) Number of moles of H2 = 2.85 moles.…

Q: 5 O2 + 2 C6H12 ----------------------> 2 C6H10O4 + 2 H2O…

A: The given data- The number of moles of adipic acid = 40 The mass of cyclohexane = 164 g The…

Q: If 2.65 moles of H2 and 1.55 moles of O2 react how many moles of H20 can be produced in the reaction…

A: Hydrogen and oxygen gas combine together to form water. Write the balanced reaction of hydrogen and…

Q: If 2.55 moles of H2 and 1.55 moles of O2 react how many moles of H20 can be produced in the reaction…

A: 2 H2 (g) + O2(g) ---> 2H2O (g) Moles of H2 = 2.55 moles Moles of O2 = 1.55 moles Moles of H2O…

Q: Given the following reaction: 2 C2H6(l) + 7 O2(g) => 4 CO2(g) + 6 H2O(l) How many moles of…

Q: According to the balanced reaction below, calculate the moles of NO2 that form when 5.20 x 10 mol of…

A: A balanced chemical equation is the complete representation of a chemical reaction. In a balanced…

Q: A welder's propane (C 3H 3) torch is powered by a combustion reaction. The reaction is shown below:…

Q: Determine the moles of CO, produced when 4.04 moles of O, reacts with CH, 2 2 according to the…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

101 Chem101
X D The Periodic Table Song (2 X
G How many moles of nitro
X
G what is the molar mas
Piazza
A app.101edu.co
Apps
MyUSU O Outlook Canvas
Labflow OneNote 101 Chem101
Tophat
Question 20 of 24
If 2.30 moles of H, and 1.55 moles of O, react how many moles of H,O
can be produced in the reaction below?
2 H,(g) + O,(g) → 2 H,O(g)
esc
F2
F3
ES

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

itamin B12 , cyancobalamin, is essential for human nutrition. Its molecular formula is C63H88CoN14O14P . A lack of this vita min in the diet can lead to anemia. Cyanocohalamin is the form of the vitamin found in vitamin supplements. l type='a'> What is the molar mass of cyanocobalamin to two decimal places? How many moles of cyanocohalamin molecules are present in 250 mg of cyanocobalamin? What is the mass of 0.60 mole of cyanocobalamin? How many atoms of hydrogen are in 1 .0 mole of cyanocobalamin? What is the mass of 1.0107 molecules of cyanocobalamin? What is the mass (in grams) of one molecule of cyanocobalamin?
Atoms of three different elements are represented by O, , and . Which compound is left over when three molecules of O. and three molecules of . react to form O. And O?
When elemental carbon is burned in the open atmosphere, with plenty of oxygen gas present, the product is carbon dioxide. :math>C(s)+O2(g)CO2(g) wever, when the amount of oxygen present during the burning of the carbon is restricted, carbon monoxide is more likely to result. :math>2C(s)+O2(g)CO(g) at mass of each product is expected when a 5.00-g sample of pure carbon is burned under each of these conditions?
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Sodium borate decahydrate, Na2B4O710H2O is commonly known as borax. It is used as a deodorizer and mold inhibitor. A sample weighing 15.86 g is heated until a constant mass is obtained indicating that all the water has been evaporated off. (a) What percent, by mass of Na2B4O710H2O is water? (b) What is the mass of the anhydrous sodium borate, Na2B4O7?
Air Pollution Nitrogen monoxide, which is present in urban air pollution, immediately Converts to nitrogen dioxide as it reacts with oxygen. a. Write the balanced chemical equation for the formation of nitrogen dioxide from nitrogen monoxide. b. What mole ratio would you use to convert from moles of nitrogen monoxide to moles of nitrogen dioxide?
For each of the following incomplete and unbalanced equations, indicate how many moles of the second reactant would be required to react completely with 0. 145 mole of the first reactant. msp;BaCl2(aq)+H2SO4(aq) msp;AgNO3(aq)+NaCl(aq) msp;Pb(NO3)2(aq)+Na2CO3(aq) msp;C3H8(g)+O2(g)
Copper(I) iodide (CuI) is often added to table salt as a dietary source of iodine. How many moles of CuI Are contained in 1.00 lb (454 g) of table salt containing 0.0100% CuI by mass?
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
Phosphine gas reacts with oxygen according to the following equation: 4PH3(g)+8O2(g)P4O10(s)+6H2O(g) Calculate (a) the mass of tetraphosphorus decaoxide produced from 12.43 mol of phosphine. (b) the mass of PH3 required to form 0.739 mol of steam. (c) the mass of oxygen gas that yields 1.000 g of steam. (d) the mass of oxygen required to react with 20.50 g of hosphine.
Consider the balanced equation :math>C3H8(g)+5O2(g)3CO2(g)+4H2O(g) at mole ratio enables you to calculate the number of moles of oxygen needed to react exactly with a given number of moles of C3H8(g)? What mole ratios enable you to calculate how many moles of each product form from a given number of moles of C3H8?
One chocolate chip used in making chocolate chip cookies has a mass of 0.324 g. (a) How many chocolate chips are there in one mole of chocolate chips? (b) If a cookie needs IS chocolate chips, how many cookies can one make with a billionth (1109) of a mole of chocolate chips? (A billionth of a mole is scientifically known as a nanomole.)