H14). Give the major product of the following reaction.1. Br2, PBr32. CH3OHCH3CH₂-COOH(A)CH3CH₂-C-O-Br(B)OHCH3CH₂-CH-OH(C)?OCH3CH-C-OHBrP5/9(D)OCH3CH₂-C-Br(E)OCH3CH-C-OCH3Br

Answered: Image /qna-images/answer/01a3fe8c-ae9c-476c-8f87-d6e765676d55.jpg

H 14). Give the major product of the following reaction. 1. Br₂, PBr3 2. CH3OH CH3CH₂-COOH (A) CH3CH₂-C-O-Br (B) OH CH3CH₂-CH-OH (C) ? O CH3CH-C-OH Br P5/9 (D) O CH3CH₂-C-Br (E) O CH3CH-C-OCH3 Br

H 14). Give the major product of the following reaction. 1. Br₂, PBr3 2. CH3OH CH3CH₂-COOH (A) CH3CH₂-C-O-Br (B) OH CH3CH₂-CH-OH (C) ? O CH3CH-C-OH Br P5/9 (D) O CH3CH₂-C-Br (E) O CH3CH-C-OCH3 Br

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: Use Excel to determine the order and rate constant of the reaction given the following data: Time…

A: A question based on kinetics of chemical reaction in solution. A set of data of time and…

Q: 3. Calculate thepHof a mixture of30.00 mLof0.4508MHBrand18.00 mLof0.1162MCa(OH)2(Hint: Write the…

A: Given , Volume of HBr = 30.00 mLMolarity of HBr = 0.4508 MVolume of Ca(OH)2=18.00 mLMolarity of…

Q: Q.6: Prepare glycerol from Light naphtha?

A: Answer: Glycerol, also known as glycerin or glycerine, is a trihydroxy alcohol that can be prepared…

Q: Does a reaction occur when aqueous solutions of cobalt(II) chloride and lead (II) nitrate are…

A: The question is based on the concept of chemical reactions. We need to identify the reaction taking…

Q: What is AH when 1.40 mol of Sg reacts? Be sure your answer has the correct number of significant…

A: ∆H of the given reaction is = -20. 2 kJ Given moles of S8 = 1.40 moles

Q: draw the lewis for structures and determine the shape (linear, planar or tetrahedral) for: a) N2 b)…

A: a) N2 : N has 5 valence electrons. So, Both the N atom is connected with triple bonds and are sp…

Q: solution of Na2CO3 is added dropwise to a solution that is 0.0453 M in Nd3+ and 4.46e-05 M in Hg22+.…

A: The question is based on the concept of solubility product principle. It that states that when a…

Q: What is the IUPAC name of this molecule? O A

A: Answer:- This question is answered by using the simple concept of naming the organic compounds using…

Q: pH 14 H26420 12 10 8 B A ▬▬ 0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 mL base 5. At the…

A: Answer: When weak acid is being titrated against strong base then initially solution acts like a…

Q: Propose an efficient synthesis for the following transformation: Br +-m The transformation above can…

A: We will only use the given reagents to carry out the transformation

Q: The spec is chloroform, deutero. I don't know what the peaks are around 3200 cm-1, 3000 cm-1 and…

A: Infrared spectroscopy deals with the analysis of various peaks that represent the various functional…

Q: 19) What is the molar solubility of AgCl in 0. 30 M NH3? Ksp for AgCl is 1.8 x 10-10 and Kf for…

A: Answer: When AgCl is added in the ammonia solution then Ag+ ion reacts with NH3 to form a soluble…

Q: 5. Consider the following reaction: 4 NH3(g) + 5O₂ (g) ---> 6 H₂O (g) + 4 NO (g) The concentration…

A: The concentration of NH3 (g) at time 4.19 s is 0.82 mol/L. The concentration of NH3 (g) at time 37.6…

Q: Select the correct mechanism for the transformation shown. - A bod 132 13 +

A: For the above transformation free radical mechanism is involved. In free radical mechanism, bond…

Q: Part A nitrous acid, HNO2 Express your answer as a chemical formula. ΑΣΦ ? A chemical reaction does…

A: According to the Bronsted-Lowry acid base concept, the species which donates H+ ions are called…

Q: Two reactions are shown below but in various orders. Draw the structures of the products. Are the…

A: Electrophilic aromatic substitution reactions are organic reactions wherein an electrophile replaces…

Q: What is the IUPAC name of this molecule? O

A: Identify the parent chain Identify the functional group Label the carbons in parent chain in such a…

Q: ree gases are stored at 25°C in separate but connected containers. The first container is 10.0 L and…

Q: The reaction CO₂(g)+C(s) = 2CO(g) has Kp = 5.78 at 1200 K. Y Calculate the total pressure at…

Q: Provide the missing reagents. Fill in the missing reagents ? 1) 2) Br₂, FeBr ₂ 3) ? 4) ? 5) NaOH,…

A: 1) Benzene is converted into 3-hydroxy benzoic acid . 2) using a suitable starting material and…

Q: Predict the product for the following reaction. 1. LIAIH4 (excess) 2. H3O+

Q: 1. Consider the electrophilic aromatic substitution reaction below. Provide the major product and…

A: Benzene derivative gives electrophilic substitution reaction with halogen in presence of Lewis acid…

Q: A gas is compressed from an initial volume of 2 L to a final volume of 0.5 L while heat is added to…

A: The change in internal energy of a gas is given by the following equation: ΔU = Q - W where ΔU is…

Q: Combustion of methane is an important fuel source. The combustion produces CO2 and H2O. What is the…

Q: 2 moles of A combine with 2 moles of B to produce 6 moles of C and 26 kJ. What will be the change in…

Q: What is the change in internal energy (in J) of a system that absorbs 0.727 kJ of heat from its…

A: Calculate the change in internal of the system for the given thermodynamic condition.

Q: Week 8-1X с < Formula Baf: PbF SIF CaF, + Week 8- X https://app.101edu.co 739 Sunny ALEKS-3XA…

A: Solubility product (Ksp) of a sparingly soluble salt is defined as the product of ions produced at…

Q: на 14 12 10 8 2 B A D 0 0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 mL base Provide the letter for…

A: The question is based on the titrations. we are titrating a weak acid with a strong base . we need…

Q: The reaction of CH₂CH=CH-CH=CH₂ with excess bromine gives chiefly 1,2-dibromopent-3-ene…

Q: pH 14 12 10 8 6 4 2 B A E 0 0 2 4 6 8 10 12 14 16 18 20 22 24 26 28 30 mL base 4. At the equivalence…

A: Answer: When weak acid is being titrated against strong base then initially solution acts like a…

Q: Mechanism. Provide the complete mechanism for the reaction below. You must include appropriate…

A: The given reaction describes the formation of alkene from aldehyde via Wittig reaction, where a…

Q: Calculate the pH at the equivalence point in titrating 0.077 M solutions of each of the following…

A: HCl is a strong acid and NaOH is a strong base. This is the titration of strong acid vs strong base.…

Q: Find the pH of each mixture of acids. 0.085 M in HFHF (Ka=6.8×10−4)(a=6.8×10−4) and 0.230 M in…

A: Strong acid are those which can completely dissociate into H+ and other counter ions. Weak acid are…

Q: If the Ksp of BaF2 = 1.8 × 10-7 at 25 0C, calculate the molar solubility of BaF2 at 25 0C in: i.…

Q: For the spectra below, predict which might be due to CO₂ and which SiO₂. Explain your answer. 0.8…

A: IR spectra is used to identify the functional groups of unknown organic compound and in the…

Q: How many grams of sodium will react with water to produce 4.00 moles of hydrogen?

A: Sodium reacts with water and form hydrogen. We have to calculate the gram of sodium required to…

Q: 1. What compounds are obtained from the following hydrolysis reactions? of a. CH₂CH₂ b. OCH₂ + H₂O +…

A: The given reactions describes the acid catalysed hydrolysis of several carboxylic acid derivatives…

Q: Use the oxidation ladder to identify the following transformations a reduction, oxidation or neither…

A: Identify the organic trans for the given organic transformations.

Q: 1) When 4.90 g NaOH(s) is reacted with 200.0 mL 0.612 M HCl(aq), the temperature increases 14.63…

A: Since you have posted multiple questions, we can solve only the first question for you according to…

Q: A solution is made by dissolving 0.05700 moles of Ba(OH)₂ in enough water to make 400.0 mL of…

A: Number of moles of Ba(OH)2 = 0.0570 Moles Volume = 400 ml pH = ?

Q: Determine the pH during the titration of 23.3 mL of 0.331 M hydrofluoric acid (K₂ = 7.2×10-4) by…

Q: 2-Phenylacetaldehyde with benzaldehyde in the presence of sodium hydroxide undergoes a crossed aldol…

Q: Given the following transformation O IZ This reaction is H N IZ (reduction/oxidation/neither). The…

A: The reaction of amide group to amine can be done by the use of LiAlH4 . This reaction is called…

Q: Determine the correlation factor k value for 56% ethyl acetate (EA) in ethyl propionate (EP)…

A: NEANEP=Number of moles of ethyl alcoholNumber of moles of ethyl propionate AEAAEP=1.19…

Q: A 116.2 mL sample of 0.120 M methylamine ( CH3NH2; Kb = 3.7 x 10-4) is titrated with 0.240 M HNO3.…

Q: What is the IUPAC name of this molecule? NH₂ A/

A: • Name and Identify the longest chain of carbon bonded to the nitrogen atom as alkanamines.…

Q: Fill in the left side of this equilibrium constant equation for the reaction of phosphoric acid…

A: The reaction of H3PO4 with water. we have to find the expression for the equilibrium constant i.e.…

Q: Consider an amphoteric hydroxide, M(OH)2(s) , where M is a generic metal.…

Q: Predict the major and minor product (with mechanism). 8. Hydroboration-oxidation CH3 H₂C. CH₂ 1.…

A: The compounds in which a double bond is present between two carbon atoms are known as alkenes. The…

Q: Lead(II) nitrate and ammonium iodide react to form lead(II) iodide and ammonium nitrate according to…

A: Pb(NO3)2 (aq)+2NH4I(aq)⟶ PbI2 (s) +2NH4 NO3(aq) 0.430 M NH4I 641 mL of a 0.240 M Pb(NO3)2 Volume of…

Concept explainers

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.

Question

H
14). Give the major product of the following reaction.
1. Br2, PBr3
2. CH3OH
CH3CH₂-COOH
(A)
CH3CH₂-C-O-Br
(B)
OH
CH3CH₂-CH-OH
(C)
?
O
CH3CH-C-OH
Br
P5/9
(D)
O
CH3CH₂-C-Br
(E)
O
CH3CH-C-OCH3
Br

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Description about reaction

VIEW

Step 2: Explanation

VIEW

Solution

VIEW

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The appropriate product of the following reaction is: H3C- (a) (b) H3C H3C CH3 H3CO CH3 CH3 L S ******** H3CO S 1. Br₂, CH3OH 2. NaSCH 3, DMSO R CH3 SCH3 CH3 S CH3 SCH3 +R, S + R, R (c) (d) H3C. H3C H3CS CH3 ******** H3CS S S R CH3 OCH3 CH3 S CH3 OCH3 +R, S +R, R
900 15). Give the major product of the following reaction. 2. CH3CH₂CH₂1 (A) (D) O LOCH3 CH₂-OH H3CH₂CH₂C (B) 1. LDA CH₂-CH₂-CH3 LOCH3 OCH3 (E) (C) ? CH₂-CH₂-CH3 OH CH=CH-CH3 OCH3
2) a. In the synthesis of Camptothecin, a potent antitumor and antileukemic agent isolated from the stem wood of a Chinese Nyssaceae tree, the following conversion is made. Come up with a reasonable mechanism for the following conversion using proper electron pushing and reasonable chemistry. CHO NH₂ of me N-CO,Et -CO₂Et NaOH, aq EtOH R₂NH b. The following reaction is an example of Mannich reaction. Please write a reasonable mechanism. HiH N-CO,Et -CO,H H R₂N H
6). What is the major product of the following reactions? (A) -? coon 1). NaOH in ErOH, then H,O+ 2). 1 eqiv. NaOEt 3). 1 equiv. CH3Br 4). H₂O*, Heat COOB (Intramolecular Claison) COOE (B) CH₂ COOH (D) CH₂ (E) CH3 CH₂
10). What is the major product of the following reactions? H3C (A) (D) H3C H3C OEt COOEt COOH O 1). ОН- (В) (E) CH3 H3C CH3 H3C ц 2). +, Heat CH3 (C) H3C CH3
2. The structures of alkenes can affect their reactivity in the reaction with H-Br. H;C H H;C H H H H `H H;C `H H `H A B (a) Arrange the reactivity of above alkenes (A, B and C) in an increasing order. AL (b) Use the carbocation formation to show the ease of alkenes to accept a proton from HBr.
8). Give the major product of the following reaction. -а CH3CH₂-C- (A) 1). 2 eqiv. CH3MgBr 2). H₂O+ OH CH3CH₂-C-OH CH3 (B) CH3 CH3CH₂-C-OH CH3 (C) ? CH₂CH3 CH3CH₂-C-OH CH₂CH3 (D) CH3CH2-CH-OH CH3 (E) CH3 CH3-C-OH CH3
What is major product formed in the following reaction? CH3 ROOR H3C- -CH3 HC1 CH3 CH3 H. C H2 C-CH3 (A) H3C- H. -CH3 (B) H3C– CI CH3 H2 (D) (C) H3C- CI No Reaction
What steps are needed to prepare phenylacetylene, C,H,C=CH, from C,H,CH,CH,Br. Be sure to answer all parts. Step 1: Cl2 H,SO4 KOC(CH,)3 POCI, pyridine Intermediate 1: draw structure Step 2: Br2 H;SO, NANI Nall (xcess Intermediate 2: draw structure ... Step 3: H,SO, BIL Na NIL POCly xcess pyridine
Predict the products a and b in the following reaction. .COOH 1.diazotization a +b 2. heat `NH2 3.thiophene CH (В) (A) H3C-CH3 CH b a b a -- CH (C) S H3C-CH3 (D) CH b a b a
6. Write the IUPAC name for the following compounds. Show the stereochemistry whenever required (a) HO NH2 CI (b) NH2 QH но (c) он Br H. (d) (e) OH Br Br
2) Write the major products A- P for each of the following reactions. d) H,O/ H* concd. H,SO4 Br/ CCl, excess NaNH2 K M heat NH3