Decide whether or not each metal dissolves in 1 mol L-¹ HIO3(aq). Standard Electrode Potentials at 25 °C Part B Reduction Half-Reaction E° (V) Au3+ (aq) +3e Au(s) 1.50 Part C 103 (aq) +6H+ (aq) +5e 12 (s) + 3H2O(1) 1.20 Al3+ (aq) +3e → Al(s) -1.66 Write a balanced redox equation for the reaction that occurs. When entering the equation, use whole numbers as coefficients. Express your answer as a chemical equation. Identify all of the phases in your answer.

Decide whether or not each metal dissolves in 1 mol L-¹ HIO3(aq). Standard Electrode Potentials at 25 °C Part B Reduction Half-Reaction E° (V) Au3+ (aq) +3e Au(s) 1.50 Part C 103 (aq) +6H+ (aq) +5e 12 (s) + 3H2O(1) 1.20 Al3+ (aq) +3e → Al(s) -1.66 Write a balanced redox equation for the reaction that occurs. When entering the equation, use whole numbers as coefficients. Express your answer as a chemical equation. Identify all of the phases in your answer.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 38QRT

See similar textbooks

Similar questions

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
From the standard potentials Ag2SeO4(s)+2e2Ag(s)+SeO42-E0=0.355V Ag++2eAg(s)E0=0.799V calculate the solubility product constant for Ag2SeO4.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Calculate the electrode potentials for the following systems: (a) Cr2O72-(5.00 10-3 M),Cr3+(2.50 10-2 M),H+ (0.100 M)|Pt (b) UO22+(0.100 M),U4+ (0.200 M),H+ (0.600 M)|Pt