Consider the reaction 3Fe2O3(s) + H₂(g) 2Fe3O4(s) + H₂O(g) for which AH = -6.000 kJ and AS°= 88.70 J/K at 298.15 K (1) Calculate the entropy change of the UNIVERSE when 1.681 moles of Fe2O3(s) react under standard conditions at 298.15 K A Suniverse J/K (2) Is this reaction reactant or product favored under standard conditions? (3) If the reaction is product favored, is it enthalpy favored, entropy favored, or favored by both enthalpy and entropy? If the reaction is reactant favored, choose 'reactant favored'.

Consider the reaction 3Fe2O3(s) + H₂(g) 2Fe3O4(s) + H₂O(g) for which AH = -6.000 kJ and AS°= 88.70 J/K at 298.15 K (1) Calculate the entropy change of the UNIVERSE when 1.681 moles of Fe2O3(s) react under standard conditions at 298.15 K A Suniverse J/K (2) Is this reaction reactant or product favored under standard conditions? (3) If the reaction is product favored, is it enthalpy favored, entropy favored, or favored by both enthalpy and entropy? If the reaction is reactant favored, choose 'reactant favored'.

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter13: Spontaneous Processes And Thermodynamic Equilibrium

Section: Chapter Questions

Problem 22P: Use data from Appendix D to calculate the standardentropy change at 25°C for the reaction...

See similar textbooks

Similar questions

When 1.000 g of ethylene glycol, C2H6O2, is burned at 25C and 1.00 atmosphere pressure, H2O(l) and CO2(g) are formed with the evolution of 19.18 kJ of heat. a Calculate the molar enthalpy of formation of ethylene glycol. (It will be necessary to use data from Appendix C.) b Gf of ethylene glycol is 322.5 kJ/mol. What is G for the combustion of 1 mol ethylene glycol? c What is S for the combustion of 1 mol ethylene glycol?
2. Which of the following is true for a spontaneous process but not for a nonspontaneous process? Energy in the universe is concentrated conserved dispersed not conserved
Appendix J lists standard molar entropies S, not standard entropies of formation rS. Why is this possible forentropy but not for internal energy, enthalpy, or Gibbsfree energy?
What is the second law of thermodynamics? For any process, there are four possible sign combinations for Ssys and Ssurr. Which sign combination(s) always give a spontaneous process? Which sign combination(s) always give a non-spontaneous process? Which sign combination(s) may or may not give a spontaneous process?
It takes 2260 J to vaporize a gram of liquid water to steam at its normal boiling point of 100C. What is H for this process?What is the work, given that the water vaporexpands against a pressure of 0.988atm? What is U for thisprocess?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the synthesis of ammonia? 3H2(g) + N2(g) 2NH3(g)
Use data from Appendix D to calculate the standardentropy change at 25°C for the reaction CH3COOH(g)+NH3(g)CH3NH2(g)+CO2(g)+H2(g) Suppose that 1.00 mol each of solid acetamide, CH3CONH2(s), and water, H2O(l), react to give thesame products. Will the standard entropy change belarger or smaller than that calculated for the reactionin part (a)?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)
Explain why the statement No process is 100 efficient is not the best statement of the second law of thermodynamics.
A 220-ft3 sample of gas at standard temperature and pressure is compressed into a cylinder, where it exerts pressure of 2000 psi. Calculate the work (in J) performed when this gas expands isothermally against an opposing pressure of 1.0 atm. (The amount of work that can be done is equivalent to the destructive force of about 1/4 lb of dynamite, giving you an idea of how potentially destructive compressed gas cylinders can be if improperly handled!)
For the reaction BaCO3(s) BaO(s) + CO2(g), rG = +219.7 kJ/mol-rxn. Using this value and other data available in Appendix L, calculate the value of fG for BaCO3(s).