Compare the calculated cell potentials for this cell (Part C) to the sum of the calculated cell potentials from A and B. Explain your results. part A: 0.4334 V part B: 1.101 V part C: 1.534 V please explain

The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.

Determine the overall reaction and its standard cell potential at 25 C for this reaction. Is the reaction spontaneous at standard conditions? Cu(s)|Cu2+(aq)Au3+(aq)|Au(s)

Is it reasonable to conclude that a potential could be assigned to each half-cell in a voltaic cell, based on these data for three voltaic cells? Explain. Zn(s)|Zn2+(aq)||Cu2+(aq)|Cu(s) cell potential=1.10 V Zn(s)|Zn2+(aq)||Ag+(aq)|Ag(s) cell potential=1.56 V Cu(s)|Cu2+(aq)||Ag+(aq)|Ag(s) cell potential=0.46 V

An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?

For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)

What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)