Draw the major product of this mixed Claisen condensation reaction. Ignore inorganic byproducts. 1. NaNHz 2. PhCO2CH2CH3 < Draw the major product of the Claisen condensation reaction between two molecules of this ester. Ignore inorganic byproducts. 1. NaOCH₂CH3, CH3CH2OH 2. Acidic workup

Draw the major product of this mixed Claisen condensation reaction. Ignore inorganic byproducts. 1. NaNHz 2. PhCO2CH2CH3 < Draw the major product of the Claisen condensation reaction between two molecules of this ester. Ignore inorganic byproducts. 1. NaOCH₂CH3, CH3CH2OH 2. Acidic workup

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter19: Enolate Anions And Enamines

Section19.9: Crossed Enolate Reactions Using Lda

Problem JQ

See similar textbooks

Related questions

Q: Which of these is not a possible product of the following reaction: OPP E₁ Possible Products

A: For the given reaction, we have to have a product that will not form.

Q: 1. a) Give the IUPAC name of the alkyne structure F below. b) Provide the products of A through E &…

A: a.)

Q: Clearly describe how you would prepare 45mL of a 0.050M stock solution of potassium chloride…

Q: 10. a) Provide the structures of reagent 1 and 2 that are required to generate the following alkyne:…

A: Here our Target compound is an internal alkyne . It can be obtained with the help of base followed…

Q: Compound (A) rearranges to compound (B) spontaneously. a) Draw the mechanism using curved arrows,…

Q: Consider this initial rate data at a certain temperature in the table for the reaction OCI (aq) +…

A: Let the rate law equation for the given reaction is: rate=kOCl-xI-yOH-z ......(1) Where x is the…

Q: Write a mechanism that explains the formation of A.

A: Spectral data are a good source of identification of products. Here the reactants are an enamine and…

Q: 4. Which of the following is a representation of the Avogadro constant? a 1 mol of particles a ream…

A: To solve this problem we have to know about Avogadro number and number of atoms in a compound.

Q: 7) An organic acid (A) under goes ionization in water according to the equation RCODH RCOD +H* The…

Q: The standard reaction free energy AGO = 29. kJ for this reaction: Fe₂O3(g) + 2 H₂(g) →2 Fe(s) + 3…

A: Fe2O3(g) + 2H2(g) ----> 2Fe(s) + 3H2O(l) ∆G° = 29. kJ reaction ∆G° Fe(s) + 3/2H2O(l)…

Q: If a scientist weighs out 460.69 grams of ethanol, how many moles of carbon dioxide will be…

A: We have to check if the given equation is balanced and find moles of carbon dioxide produced from…

Q: امشه + H2O 7

A: The given compound is carries carbonyl, as well as secondary amine both the functional groups. This…

Q: Consider the following electrochemical cell: Pt | H₂(g,pᵒ) | HCl(aq,b) | Hg₂Cl₂(s) | Hg(1) The…

A: “Since you have posted a question with multiple sub-parts, we will solve the first three subparts…

Q: What is the percentage composition of oxygen in iron(II) oxide pentahydrate FeO.5H₂O?

A: Compound -> FeO.5H2O First of all we calculate molar mass (M)of compound Percentage…

Q: Use the References to access important values if needed for this question. Tire pressure gauges are…

A: Pressure P= 28.6 Psi 1 atm = 760 mmHg = 14.7 Psi

Q: Predict the product of the following reaction and propose a reaction mechanism •NH H*

A: This is an example of acid catalysed hydrolysis of imine bonds to afford carbonyl compounds.

Q: draw the lewis structure for the hydride anion. Give the reaction mechanism for the reaction of the…

A: A question based on introduction to chemistry. Lewis structure for hydride ion and its reaction with…

Q: Aktiv Chemistry ← → C NS NorthStar X app.101edu.co American Hotel Aktiv Chemistry Interexchange WB…

Q: what is/are the laws applied for gas and it’s temperature (explain why)

Q: 6 takeCo Use the References to access important values if needed for this question. When silver…

Q: A student dissolves 12.6 g of ammonium nitrate (NH4NO3) in 200. g of water in a well-insulated open…

A: * The temperature of the water fall from 22°C to 17.9°C As the temperature is decreased, means…

Q: 3. Which three of the following carbonyl compounds would most likely form a stable hydrate? A A. B.…

A: # For the formation of hydrate from a carbonyl compound, it depends on two things, first, the…

Q: Consider the molecular formula C4H8O. Choose which of the following molecules is NOT a structure…

A: The molecular formula given is C4H8O. The degree of unsaturation = C +1 – (H/2) C = number of carbon…

Q: How are the following pairs of carbohydrates, shown in a Fischer projection, related to each other?…

A: A question based on carbohydrates. Two pairs of carbohydrates are given that are to be related based…

Q: A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them into…

A: Given : energy absorbed by the reaction, ∆U = +252KJ where positive sign indicates energy is…

Q: Curved arrows are used to illustrate the flow of electrons. Using the provided starting and product…

A: Curved arrows shows transfer of electron from electron rich species (nucleophile) to the electron…

Q: Which of the following starting materials will provide the desired compound under the proposed…

Q: If a scientist weighs out 460.69 grams of ethanol, what is the mass of the carbon dioxide? Make sure…

A: # The given problem is an simple example of mole concept where, for a given balanced equation we…

Q: H₂N CH3 ZI O OH Which of the following statements is True? SH ZI O OH NH₂ All amino acid residues…

A: Chiral and Achiral Amino Acids: Amino acids are chiral molecules, which means that they have a…

Q: Cl₂, H₂O HCI, EtOH H3O* 1.03 2. DMS mCPBA KMnO4 H₂SO4 Hot HBr 1, Hg(OAc)2, CH₂OH 2. NaBH4

A: The question is based on organic reactions. we need to identify the product formed and explain…

Q: Which of the following is true for a gas under conditions of very low temperature? PV ÷ nRT = 1,…

A: To solve this problem we have to know about ideal gas equation.

Q: The molar conductivity of NH4Cl at infinite dilution is 149. 7 02-1 cm² mol-¹ and the ionic…

A: Λ°m (NH4Cl)=149.7 Ω-1cm2mol-1Λ°(OH-)=198.0 Ω-1cm2mol-1Λ°(Cl-)=76.3 Ω-1cm2mol-1

Q: is the answer 8.1 or 8.3

A: There is a calculation mistake in the answer given earlier.

Q: Are isobutane and hexane isotopes?

A: In chemistry, the definition of isomer is as follows - When molecules have identical chemical…

Q: The following graph shows the pH curve for the titration of 25 mL of a 0.1 M monoprotic acid…

A: Strong acid-strong base titration shows equivalence point at pH=7. Strong acid-weak base titration…

Q: C. H₂C CN H3C CH3 CN

A: To get the target molecule we have to react Ethyl acetoacetate, with viny cyanide, methyl iodide .At…

Q: Draw the major product of this reaction. Ignore inorgani byproducts. 1. excess Br2, NaOH 2.…

A: Ketones react with excess of bromine under basic condition to produce polybromoketone where are the…

Q: How many micrograms of KCI (Formula Weight: 74.55g/mole) are contained in 150mL of 250mM KCI?

Q: Provide the major organic product that results when benzene is treated with the following sequence…

A: Benzene show electrophilic aromatic substitution reaction. It react with HNO3/H2SO4 to form…

Q: What is the concentration (in molarity units) of a solution which is prepared by dissolving 4.94 g…

A: The question is based on the concept of molarity. molarity is a method of expressing concentration…

Q: I need help to find the mechansim for Preparation of Cyclohexanone by CrO3/H2SO4-acetone and…

A: This is a type of oxidation reaction

Q: 3. In an experiment, 62.0 g of sulfur trioxide, SO3 reacts with excess water, H₂O, producing 24.0 g…

A: mass of sulfur trioxide (SO3) reacts = 62.0 g Excess reactant: water (H2O) Actual yield sulfuric…

Q: Explain by means of reaction equations how you would synthesize each of the following compounds.…

A: “Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: If a scientist weighs out 460.69 grams of ethanol, how many moles of carbon dioxide will be…

A: Correction: chemical formula of ethanol is C2H5OH not C6H5OH C2H5OH(l) + O2(g) -----> CO2(g) +…

Q: 11. Draw the structure for the molecule that would yield the products shown below under the…

A: The given reagent is hydrogen bromide, which shows addition reaction into alkene. In both the side,…

Q: Calculate the concentration of all species, pH and Ka for 0.100 M acetic acid (assume 1.35…

A: The ionization of acetic acid can be represented by the following chemical equation:CH3COOH ⇋…

Q: Is CH3-CH2-CH2-CH3 an Alkane?

Q: A student mixes 50.mL of 0.15 M Na2CO3 and 50.0 of 0.15 M CaCl2 and collects 0.68 g of dried CaCO3.…

A: Given, Molarity of Na2CO3 = 0.15 M Volume of Na2CO3 = 50.0 mL Molarity of CaCl2 = 0.15 M Volume of…

Q: 7. Using curved-arrows, transformation stereochemistry propose a mechanism for the following and…

Q: Identify a solution that will form a precipitate when mixed with aqueous sodium carbonate,…

A: The precipitation reactions are the reaction which produce a product that is insoluble in the…

Question

100%

Draw the major product of this mixed Claisen condensation
reaction. Ignore inorganic byproducts.
1. NaNHz
2. PhCO2CH2CH3
<

Draw the major product of the Claisen condensation reaction
between two molecules of this ester. Ignore inorganic
byproducts.
1. NaOCH₂CH3, CH3CH2OH
2. Acidic workup

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1: Introduce question

VIEW

Step 2: Explain mechanism

VIEW

Solution

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Protection of Groups in Organic Synthesis

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Answer all three parts plz. You are starting with three aryl bromides. They undergo a typical grignard reaction with magnesium metal and anhydrous ether (diethyl ether). Dry ice is then added to it and it is then cooled. Draw and label the names of the aryl carboxylic acids that will form for each. Part a) bromobenzene Part b) para-bromoanisole Part c) meta-bromoanisole
Draw the major product of this reaction. Ignore inorganic byproducts. 1. LIAI(OET)3H, -78 °C 2. H₂O CI
Draw the major product of this reaction. Ignore inorganic byproducts. 1. B2H6, THF 2. H2O2, NaOH decore
Draw the major product of this reaction. Ignore inorganic byproducts. 1. B2H6, THF 2. H2O2, NaOH Q
#16b. Provide the missing reactants, reagents, or products for the following reaction sequences below.
Draw the organic product(s) of the following reaction. CH3 O CH3CHCH₂CH₂COH 1. Br2, PBr3 2. H₂O
True or False1. As the alkyl chain increases in molecular weight among primary alcohol, the solubility in water increases2. An ethoxide ion exhibits greater proton-accepting property compared to an ethyloxonium ion3. Phenol is mroe acidic than cyclohexyl alcohol due to the electron-donating ability of phenolic oxygen
e) sec-butyl bromide • Question 2: Identify the nucleophile and leaving group and draw the products of each reaction. a. b. Br + + OCH₂CH3 NaOH d. Br + N3 + NaCN
Draw the major product of this reaction. Ignore inorganic byproducts. 1. Ag2O, NH4OH 2. Neutralizing work-up O Q
When toluene is treated with sulfuric and nitric acids under special conditions, three nitro (NO2) groups are substituted for hydrogens at the 2, 4 and 6 positions on the ring (the next section discusses why the 2, 4, and 6 positions are substituted). The product is a highly explosive substance called 2,4,6-trinitrotoluene. This subastance is commonly known by a three letter name. What is it?
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
c) The epoxide shown below gives a positive chromic acid test. Clearly explain this result. H3C, `CH3 d) The acetal shown below gives a positive chromic acid test. Clearly explain this result. OCH3 H3C. OCH3