A 2.500 mol sample of phosphorus pentachloride, PC15, dissociates to give 0.338 moles of phosphorus trichloride, PC13, at equilibrium according to the equation: PC15(g) → PC13(g) + Cl₂(g) What is the composition of the final reaction mixture in moles of each component? Give your answers to the nearest thousandth. type your answer... mol PC13, type your answer... mol Cl2 type your answer... mol PC15,

Q: 6. It takes 14.5 mL of 0.475 M NaOH to reach the equivalence point of a titration with 10.0 mL of a…

A:

Q: For each system listed in the first column of the table below, decide (if possible) whether the…

A: The given problem is based on the concept of entropy of a substance.

Q: Convert the following measurement. -6 kg 9.6 × 10 mol dL -0- 6.D mol. L

A:

Q: If you had 4.39 moles of LiOH, how many grams would you have? And What is the volume (liters) of…

A:

Q: Which of the following compounds has the higher melting point? (ignore difference in strength of…

A: In case of hydrocarbons , due to branching present in the compound, the surface area of molecules…

Q: A 0.16-g sample of a purified protein is dissolved in water to give 2.0 mL of solution. The osmotic…

A: Given:- mass of solute= 0.16 g Volume(V) = 2 mL = 0.002 L  Osmotic presure (π) = 18.1 torr =…

Q: 4) A compound called vinyl chloride has a composition of 38.43% carbon, 4.838% hydrogen, and 56.72%…

A: we have to find the molecular formula of polyvinyl chloride

Q: Show the reaction of 3,4,5-trihydroxybenzoate (gallic acetate) with an ORS (oxygen reactive…

A: To show the reaction between the 3,4,5-trihydroxybenzoate (gallic acetate) with an ORS (oxygen…

Q: 6. What volume of 1.50 M NaCl is needed for a reaction that requires 146.3 g of NaCl? 1.67 L 7. What…

A: Here we are required to find the Molarity of the solution.

Q: This isn't a question to mathematically solve. I'm just curious if you could please explain what…

A:

Q: mass of Na2CO3 (grams) moles of Na2CO3 V final, volume dilute HCl at endpoint (mL) V initial, volume…

A: Molar mass of Na2CO3 = 105.99 g/mol  Required conversion factor is: 1 mol Na2CO3 = 105.99 g Na2CO3…

Q: ALCOHOLS 1. WHY IS METHANOL MORE TOXIC THAN ETHANOL? 2. FROM WHAT ALKENE IS ETHANOL MADE? DRAW ITS…

A: Here we have to explain why methanol is more toxic than ethanol and the preparation of ethanol from…

Q: this compound is not aromatic because it possesses an allene group , which is C=C=C. I dont see…

A: The allene system can be represented as –CH=C=CH– group.

Q: One mole of ag and one mole of au contain the same number of atoms true or false

A: Yes

Q: What mass in grams of tin would be required to completely react with 1.65 L of 0.750 M HBr in the…

A: Mole is defined as mass of substance divide by it's molar mass

Q: each reaction in the table below, write the chemical formulae of any reactants that will be oxidized…

A: The element which has oxidation state increases in a reaction that is oxidized and the element which…

Q: 218 ac D 08 ac dr Solve for the concentration profile at steady state assuming a concentration C =0…

A: Steady state solutions can be applied when the concentration gradient may vary in space but does not…

Q: Modify the given structure of the product to draw the required aldol condensation starting…

A: Carbonyl compounds having alpha H-atom in the presence of a base undergo condensation reaction to…

Q: Draw the six possible Newman projections for 3-ethylpentane about C2 and C3. Label each drawing…

A: Here we have to write six Newman conformations of 3-ethylpentane and to indicate the most stable…

Q: Write an equation that shows the process corresponding to the first ionization energy of Hg. Express…

A: Ionization energy : It is the minimum amount of energy absorbed by an isolated gaseous atom that…

Q: Use the MO diagram (below) to calculate the bond order for OF™. * Op * Os * * - Пр

A: Bond order = (bonding electrons - anti bonding electrons)2

Q: Wine goes bad soon after opening because the ethanol CH3CH2OH dissolved in it reacts with oxygen…

A: Concept:  Ethanol undergo easy reaction with the atmosphere oxygen and gives the acid. For…

Q: Al4C3 (s)    +  12 H2O (l)     →   4 Al(OH)3 (s)   +  3 CH4 (g)  In this reaction, 0.3455 mol of…

A:

Q: Which of the following is a correct resonance structure of I? 1 I Select one: O A. 3 OB. 2 O C. 1…

A:

Q: (1) Provide a plausible mechanism for the following aldol reaction. Draw the line formula of all…

A: "Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Which of the following applies to the following pair of molecules (Hint; count all of the carbon…

A:

Q: ANSWER THE FOLLOWING: 1. DRAW THE STRUCTURE OF M-IODOPHENOL 2. DRAW THE STRUCTURE OF…

A:

Q: redox hydrogenation oxidation lose(s) gain(s) energy oxidized reduced reduction The reactions of the…

A: The given problems can solved on the basic concepts of chemistry.

Q: Calculate the cell potential for the reaction as written at 25.00 °C, given that [Cr2+]=0.805 M and…

A:

Q: reaction 2K CIO3(s)→ 2K Cl(s) + 30₂ (g) HI(aq) + NaOH(aq) Nal(aq) + H₂O (1) 4 2CH₂CH₂(g) + 70₂(g) →…

A: Given that, Some examples of reaction and we have to identify the type of reaction.

Q: For each of the salts on the left, match the salts on the right that can be compared directly, using…

A: Given : a formula of compounds. Tip : we will dissociate compounds into ions to solve.

Q: Macmillan Learnin Loudon | Parise SEVENTH EDITION Consider the resonance structures for the…

A:

Q: What is the lipid number nomenclature for this structure? OH A) C16:3 B) C17:3 C) C18:2 D) C20:3 E)…

A: we have to determine the lipid number nomenclature for the given structure

Q: g) + H₂O (g) H₂ (g) + CO₂ (g) ulate the concentration of all four species at equilibrium if the…

A: Equilibrium constant is equal to the concentration of product divide by concentration of reactant

Q: CH3CH₂CH(CH2CH3)CH₂CH₂CH3 Draw the molecule on the canvas by choosing buttons from the Tools (for…

A: Given -> 1-> CH3CH2CH(CH2CH3)CH2CH2CH3 2-> CH3CH(CH3)CH2CH2OH

Q: How many moles of CH4 are 4.5x1022 CH4 molecules? NOTE: It is not necessary to include units on your…

A: Given that:  Molecules of CH4 = 4.5×1022

Q: 5. How many moles of potassium hydroxide would have to be added to 245 mL of a 0.346 M acetic acid…

A: Given -> Volume of acetic acid = 245 ml = 0.245 L (1L=1000ml) Molarity of acetic acid= 0.346 M pH…

Q: Hydrogen reacts with oxygen to produce water as follows: 2H₂(g) + O₂(g) → 2H₂O(g) How many moles of…

A:

Q: The equilibrium for the reaction for the decomposition of PCl5 to chlorine and PCl3 is 0.042.…

A: PCl5(g) <....> PCl3(g) + Cl2(g) Given that:  Kc = 0.042 Equillibrium concentration: [PCl3] =…

Q: Show how you might use SN2 reactions to convert 1-chlorobutane into the following compounds. (a)…

A: Note : As per our company guidelines we are supposed to answer only first 3 sub-parts. Kindly repost…

Q: what is the process of hydrolysis of starch? explain.

A: A ploymeric carbohydrate known as starch is composed of many glucose units bound together by…

Q: Choose the compounds in which the central metal cation exhibits the inert-pair effect. SnCh INNO3…

A: Some elements of post transition metals shows an abnormal character while forming compounds. They do…

Q: OH Select the correct lipid number for the structure below. A) C30:0 B) C26:0 C) C20:0 D) C18:0 E)…

A:

Q: Determine the products for the elimination reactions in the next two questions. HCI H 1 1 1…

A:

Q: Suppose that CaCl2 is added as an impurity to CaO. If the Cl- substitutes for O2- , what kind of…

A: Given :  Suppose that CaCl2 is added as an impurity to CaO. If the Cl- substitutes for O2-

Q: Osmolarity calculations solute moles of solute 2.40 moles KCI KCI KCI KCI glucose C6H12O6 glucose…

A: KCl produce two ions and so osmole of KCl = 2 × mole of KClmass in g = mole × molar massFor glucose,…

Q: mass of Na2CO3 (grams) moles of Na2CO3 V final, volume dilute HCl at endpoint (mL) V initial, volume…

A:

Q: 11. How many mL of a 1.35 M solution will contain 8.20 mole NaOH? 8.20 mole -6.074L 1.35m 6070 mL…

A:

Q: Complete and balancing the following equation and then write the ionic and net ionic equations for…

A:

Q: 8. Butane, which is the fuel used in cigarette lighters, combusts according to the following…

A: Here 10 g of butane was combusted  and heat produced is used for heating 25L water at 22°C. We have…