89. The differential pulse polarogram of 3.00 mL of solution containing the antibiotic tetracycline in 0.1 Macetate, pH 4, gives a maximum current of 152 nA at half-wave potential of -1.05 V. (vs S.C.E). When 0.500 mL containing 2.65.ppm of tetracycline was added, the current increased to 206 nA. How much tetracycline, in ppm, is in the original solution?

89. The differential pulse polarogram of 3.00 mL of solution containing the antibiotic tetracycline in 0.1 Macetate, pH 4, gives a maximum current of 152 nA at half-wave potential of -1.05 V. (vs S.C.E). When 0.500 mL containing 2.65.ppm of tetracycline was added, the current increased to 206 nA. How much tetracycline, in ppm, is in the original solution?

Appl Of Ms Excel In Analytical Chemistry

2nd Edition

ISBN:9781285686691

Author:Crouch

Publisher:Crouch

Chapter11: Dynamic Electrochemistry

Section: Chapter Questions

Problem 10P

See similar textbooks

Similar questions

At what pH does Ecell = 0.00 V for the reduction of dichromate by iodide ion in acid solution, assuming standard-state concentrations of all species except H+ ion?
For the following half-reaction, = 2.07 V: A1F63(aq)+3eAl(s)+6F(aq) Using data from Table 17-1, calculate the equilibrium constant at 25C for the reaction A13+(aq)+6F(aq)A1F63(aq)K=?
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
How long would it take to titrate 1.00 mmol H2S with a current of 100.0 mA?
The following cell was found to have a potential of 0.2897 V:SCEIIMg2+(a = 3.32 * 10^-3M)membrane electrode for Mg^2+(a) When the solution of known magnesium activity was replaced with an unknown solution, the potentialwas found to be 0.2041 V. What was the pMg of this unknown solution?(b) Assuming an uncertainty of 60.002 V in the junction potential, what is the range of Mg21 activitieswithin which the true value might be expected?(c) What is the relative error in [Mg^2+] associated with the uncertainty in Ej?
A total of 4 mL of a solution containing 1,222 mg/mL of cyclohexene was titrated coulometrically. If a constant current of 9.650 mA is applied, how long will the titration take ?
Subject Year Month, 58 Discuss the mechanism by which the potential of a platinum electrode becomes poised by immer- sion into a solution of Fe(II) and Fe(III) in 1 M HCl. Approximately how much charge is required to shift the electrode potential by 100 mV? Why does the potential become uncertain at low concentra- tions of Fe(II) and Fe(III), even if the ratio of their concentrations is held near unity? Does this ex- perimental fact reflect thermodynamic considerations? How well do your answers to these issues apply to the establishment of potential at an ion-selective electrode? Date. فصل دوم مراجع استاد
Nitrobenzene contained in 310 mg of an organic mixture was reduced to phenylhydroxylamine at a constant potential of 20.96 V applied to a mercury cathode: C6H5NO2 + 4H+ + 4e- → C6H5NHOH + H2O. The sample was dissolved in 100 mL of methanol. After 30 min of electrolysis, the reaction was considered complete. An electron coulometer in series with the cell indicated that the reduction required 33.74 C. Calculate the percentage of C6H5NO2 in the sample.
4. 5 mL of 0.006 M arsenite (As2O3) solution is subjected to coulometric titration as described in this laboratory using a current of 30 mA. Calculate the time that the current should be applied to reach the endpoint of the titration. INTRODUCTION:
An electrochemical cell similar to the cell in Experiment 3 is constructed, but instead of using Cu electrodes and a Cu²+ solution, this cell uses Pb electrodes and a Pb²+ solution. Pb|Pb+²(1 M)||AsO(~ 1 M)|Pb₂ (AsO₂)₂(s) Pb(s) The measured potential, Ecell of this cell is -0.349 V. Calculate Ksp for Pb, (ASO₂)₂. Ksp = 1.479 x10¹2 Incorrect
In a polarographic experiment of a 60 mL of 0.08 M Cu2+solution, a limitingcurrent was left on for 15 minutes. If the average current during the time of theexperiment is 6.0 μA, what fraction of the copper is removed from the solution? TheFaraday constant is 96485 C/mol of electron.
For the cell below, the standard potential is Eocell = 1.62 V ( F =96500 C/mole e-)( 1VC=1J) Mg(s) | Mg2+ (1M) || Zn 2+ (1M) | Zn (s)Calculate ΔGo for the cell at standard conditions in kJ. Select one: a. -1.62 kJ b. -313 kJ c. -3.13 x 105 kJ d. -156 kJ