Answered: 4.How will each change affect the…

4.How will each change affect the reaction? H2(g) + 1z(g)=2HI(g) AH=-9.48kj a. Addition of H2 b. Removal of H2 C. Increasing temperature

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter17: Spontaneity, Entropy, And Free Energy

Section: Chapter Questions

Problem 120CP: The equilibrium constant for a certain reaction decreases from 8.84 to 3.25 102 when the...

See similar textbooks

Related questions

Q: 14. Consider the reaction at 25 oC : A (g) + B (s) + 2 C (g) ------ D (g) + 2 E (s) kp = 2.40 What…

A: The given reaction is - A (g) + B (s) + 2 C (g) ------ D (g) + 2 E (s) Now, the…

Q: 3.) Consider the reaction below. Reaction: 2 ICI (g) 1: (g) Cl: (g) AH°f 17.78 (kJ/mole) S° 247.551…

Q: The oxidation of ammonia into nitric oxide is an exothermic process. 4NH,(g) + 50(g) = 4NO(g) +…

A: Le Chatelier's principle: According to the Le Chatelier's principle when a change in concentration…

Q: At a specific temperature, the reaction: 2 H20(g) +2 H2(9) + O2(g) has Keg = 1.40 x 10-4. At the…

Q: In a study of glass etching, a chemist examines the reaction between sand (SiO2) and hydrogen…

Q: Nitrogen and oxygen react at high temperatures.(a) Write the expression for the equilibrium constant…

A: In a reaction a stage where both reactant and product are present, but their change in concentration…

Q: For the reaction 2NO(g) + Cl2(g) 2NOCI((g) H° = 51.7 kJ/mol. What will be the effect if the…

A: Given reaction: H° = 51.7 kJ/mol. To predict: The effect if the temperature of the reaction system…

Q: Consider the following equilibrium reaction and its value of AH°. N204 (g) 4 2 NO2 (g) AH° = 57 kJ…

Q: Consider the following equilibrium in a closed vessel: H 2 (g) + I 2 (g)------- >2 HI (g) H =…

A: Endothermic reactions can be defined as a chemical reaction in which the reactant species absorbs…

Q: NH4HCO3(s) ⇌ NH3(g) + CO2(g) + H2O() Calculate ΔG at 298K for this reaction when the pressures of…

Q: Given this equilibrium, H2(g) + I2(s) + 53 KJ22HI(g) Which change would result in the production of…

A: The given reaction is H2(g)+ I2(g) +53kJ <-------> 2HI(g) We have to find out the change that…

Q: Reaction 2: CO₂ (g) + H₂(g) (A)cooling the reaction: (B) adding more H2 into the reaction:…

A: Given: CO2( g)+H2( g)⟹CO(g)+H2O(g) ΔH=-60KJ 2NO2 (g) ⇌N2O4 (g) ΔH=+1.15 kJ

Q: The equilibrium constant at 25°C for the reaction 2 NO2(g) 2 N,O4(g) is 6.8. At 200°C the…

A: It is given that at The relationship between equilibrium constant and temperature is given by the…

Q: Calculate AG for the reaction given below if the partial pressure of NO2 is 0.229 atm and the…

Q: For the reaction, H2(g, 1 atm) + Cl2(g, 1 atm) 25°C is -45,400 cal. Find AF for the process 2 HCI(g,…

Q: onsider the reaction: SO2(g) + O3(g) → SO3(g) + O2(g). The reaction will NOT be affected by the…

A: We have SO2(g) + O3(g) → SO3(g) + O2(g) From the reaction we can see that all the reactants are gas

Q: gaseous N2O4: N2O4(g) → 2 NO2(g) ΔH° = +57.1 kJ/mol; ΔS° = +175.8 J/mol K a) Is the reaction…

A: We will give information about all parts

Q: For the reaction N2(g) + O2(g)------>2NO(g) H° = 181 kJ and S° = 24.9 J/K The equilibrium…

A: Given, ∆H° = 181 kJ and ∆S° = 24.9 J/K Equilibrium constant to be greater than 1 ∆G< 0 ∆H° -…

Q: At 3000 K, the partial pressures of A, B and C are 0.6, 0.4 and 0.2 atm, respectively. Calculate a…

A: Given data, at 3000 K , PA=0.6 atm , PB=0.4 atm, PC=0.2 atm ∆G°=?

Q: Acetic acid, CH3CO2H, can form a dimer, (CH3CO2H)2, in the gas phase.2CH3 CO2 H(g) ⟶ (CH3 CO2…

A: The reaction for the formation of dimer of acetic acid is as follows: Total strength of the bond…

Q: For the following reaction 2NO₂(g) ⇌ N₂O₄(g) ∆H° = -58.02 kJ/mol and ∆S° = -176.6 J/mol･K. What is…

A: The reaction is – 2NO2g ⇔N2O4g Pressure 0.2 0.2Qp…

Q: 5.) Consider the reaction below. Reaction: AH°r 2 ICI (g) 17.78 1 (g) Ch (g) (kJ/mole) 247.551…

A: The reaction which moves forward and backwards both are known as reversible reactions. When the rate…

Q: (BFN = (8)F0÷ + (3%OS= (3FOS NO(g) 50(g) AH° = -90.2 kJ (a) (b) AH° = +98.9 kJ Using Le Chatelier's…

A: Exothermic reaction are those in which heat is released and endothermic reaction are those in which…

Q: Nitrogen and oxygen react at high temperatures. For the reversible reaction, N2(g) + O2(g) ⇌ 2NO(g)…

A: Since you have posted question with multiple subparts as per guidelines we can answer three per…

Q: Consider the reversible reaction shown below: 2 N2O(g)+O2(g) ⇌ 4 NO(g)2 N2O(g)+O2(g) ⇌ 4 NO(g)…

A: The equilibrium constant Kc of a reaction represents the extent of a chemical reaction. The higher…

Q: 2. How is the equilibrium position of this reaction affected by the following changes? (explain each…

A: This can be explained on Le Chatelier's principle. Le Chatelier's principle is used to predict the…

Q: For the reaction 4HC(g) + O;(g)2H,O(g) + 2Cl,(g) AH° =-114 kJ and AS° --129 J/K AG° would be less…

A: For the given reaction:- 4HCl(g) + O2(g)→2H2O(g) + 2Cl2(g) ∆Ho = -114 kJ = -114000 J…

Q: Consider the equation 2SO 2 (g) + O 2 (g) ↔ 2SO 3 (g). Increasing the pressure __________. A.…

A: Given:The equation is

Q: Q: Consider the decomposition of hydrogen peroxide, shown below. 2H2O20) 2H2Ou) O2(9) + A) This is…

A: In an exothermic reaction, heat is a product of the reaction and present on the product side.…

Q: DISE 8 Phosphorous and chlorine gases combine to produce phosphorous trichloride: c+O P2(g) + 3C12…

A: Given: Partial pressure of P2 (PP2) = 1.5 atm Partial pressure of Cl2 (PCl2) = 1.6 atm Partial…

Q: 5. What is the effect of a catalyst on a reaction? A. It increases the rate. B. It decreases the…

A: A catalyst decreases energy of activation. It does not have effect on equilibrium, entropy or…

Q: Which way will the equilibrium shift for the reaction 2NO2 2NO- 02 (AH=-83 kJ) if: Pressure is…

A: Answer:- 2NO2 = 2NO + O2 ,dH= +83 kj It is an endothermic process ( dH = + ve). When,…

Q: 17 13 Balance each reaction and write its reaction quotient, O: (a) C,H(g) + O2(g) CO2(g) t H,0(g)…

A: Reaction quotient is the relationship between the ratio of the concentrations of the products and…

Q: At

Q: For the following reactions at constant pressure, choose the correct relationship between AH and AE.…

A: The relationship between ∆H and ∆E at constant pressure condition is shown below,

Q: Determine how the following changes affect the given equilblirium reaction that is held in a closed…

A: Le Chatelier's principle: This principle is used to predict the effect of a change in conditions on…

Q: Consider this reaction at equilibrium: 2 H2O2(g) = 2 H20(g) + O2(g) AH°rxn = -210 kJ/mol Which of…

Q: Consider this reaction at equilibrium. 25O2(g) + O2ig) + 2SO3{g) AH = -198 kJ Which of these changes…

Q: A flask contains NH4Cl(s) in equilibrium with its decomposition products.For this reaction, ∆H is…

A: Le-Chatelier's principle: According to this principle, if a system at equilibrium is perturbed by…

Q: Following reaction occurs at 25°C. 1000 2NO(g, 1x10 atm) + Cl, (g, 1x 10 atm) 2NOCI(g, 1Aotatm) AG°…

A: Hello. Since your question has multiple parts, we will solve the first question for you. If you want…

Q: For the following endothermic reaction at equilibrium: H2S(g) H2(g) + 1/8 S8(s) choose the action…

A: A question based on equilibrium concept, which is to be accomplished.

Q: At 298 K, the formation of ammonia has a negative ∆S0sys. Calculate ∆Ssurr N2(g) +…

A: The balanced thermodynamic reaction given is N2 (g) + 3 H2 (g) → 2 NH3 (g) ∆S°sys = – 197 J/K

Q: Water gas, a mixture of H₂ and CO, is an important industrial fuel produced by the reaction of steam…

A: Answer: These questions are based on Le-chatalier's principle, according to which, on changing any…

Q: Phosphorous and chlorine gases combine to produce phosphorous trichloride: P2(g) +…

A: The relationship between the change in free energy (∆G) with the reaction quotient (Q) is expressed…

Q: Kp for the following reaction is 0.16 at 25 0C. 2NOBr(g)=2NO (g)+ Br2 (l) the enthalpy change for…

A: Given : Kp= 0.16 Temperature= 25°C Enthalpy change of Reaction= +16.1 KJ. To find:a) what will…

Q: A) For the reaction: 2CH4(g)⇌C2H2(g)+3H2(g) Kc= 0.130 at 1613 ∘C. -What is Kp for the reaction at…

A: T = temperature in Kelvin R = gas Constant = 0.08206 L.atm/mol.K By using this we can calculate the…

Q: 17. The thermochemical equation for the reaction of F2 and water is as follows. AH = -270 kJ F2(g) +…

Q: 17.12 Balance each reaction and write its reaction quotient, Qe: (a) NO(g) + 02(g) = N,0;(g) (b)…

A: Introduction: The reaction quotient is the concentration of product divided by the concentration of…

Q: What is the effect of adding a catalyst on a reaction? O It changes the equilibrium position OIt…

A: Catalyst: Catalyst can be define as a substance Which is not consumed in a chemical reaction but…

Question

100%

4.How will each change affect the reaction?
H2(g) + 12(g)=2HI(g) AH=-9.48kj
a.
Addition of H2
b.
Removal of H2
C.
Increasing temperature
d. Decreasing temperature
e.
Increasing
volume
f.
Decreasing
volume

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step by step

Solved in 4 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Consider the equation G = G + RT ln(Q). What is the value of G for a reaction at equilibrium? What does Q equal at equilibrium? At equilibrium, the previous equation reduces to G = RT ln(K). When G 0, what does it indicate about K? When G 0, what does it indicate about K? When t G = 0, what does it indicate about K? G predicts spontaneity for a reaction, whereas G predicts the equilibrium position. Explain what this statement means. Under what conditions can you use G to determine the spontaneity of a reaction?
Explain why an equilibrium between Br2(l) and Br2(g) would not be established if the container were not a closed vessel shown in Figure 13.5.
Why are there no changes specified for Ni in Exercise 13.61, part (f)? What property of Ni does change?
Calculate G for the dissolution of both sodium chloride and silver chloride using data from Appendix E. Explain how the values you obtain relate to the solubility rules for these substances.
The equilibrium constant for a certain reaction decreases from 8.84 to 3.25 102 when the temperature increases from 25C to 75C. Estimate the temperature where K = 1.00 for this reaction. Estimate the value of S for this reaction. (Hint: Manipulate the equation in Exercise 79.)
Murphy's law is a whimsical rule that says that anything that can go wrong will go wrong. But in an article in the Journal of Chemical Education, Frank Lambert writes, "Murphy's law is a fraud." He also writes, "The second law of thermodynamics is time's arrow, but chemical kinetics is its clock." Read Lambert's article (J. Chem. Ed., 74(8), 1997, p. 947), and write an essay explaining, in the context of the latter quotation, why Lambert claims that Murphy's law is a fraud.
Consider the reaction CO(g)+H2O(g)CO2(g)+H2(g) Use the appropriate tables to calculate (a) G at 552C (b) K at 552C
The following equilibrium is established in a closed container: C(s)+O2(g)CO2(g)H=393kJmol1 How does the equilibrium shift in response to each of the following stresses? (a) The quantity of solid carbon is increased. (b) A small quantity of water is added, and CO2 dissolves in it. (c) The system is cooled. (d) The volume of the container is increased.
Consider the reaction 2SO2(g)+O2(g)2SO3(g) (a) Calculate G at 25C. (b) If the partial pressures of SO2 and SO3 are kept at 0.400 atm, what partial pressure should O2 have so that the reaction just becomes nonspontaneous (i.e., G=+1.0 k J)?
Hydrogenation, the addition of hydrogen to an organic compound, is an industrially important reaction. Calculate rH, rS, and rG for the hydrogenation of octene, C8H16, to give octane, C8H19 at 25 C. Is the reaction product- or reactant-favored at equilibrium? C8H16(g) + H2(g) C8H18(g) Along with data in Appendix L, the following information is needed for this calculation.
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
Consider the reaction: PCl3(g)+Cl2(g)PCl5(g) At 25C, H = 92.50 kJ. Which of the following statements is( are) true? a. This is an endothermic reaction. b. S for this reaction is negative. c. if the temperature is increased, the ratio PCl5PCl3 will increase. d. G for this reaction has to be negative at all temperatures. e. When G for this reaction is negative, then Kp is greater than 1.00.