Answered: 4. What is the correct formula for the…

4. What is the correct formula for the ester produced when ethyl alcohol, CH3CH2-OH, is reacted with butyric acid (CH,CH,CH,-Ĉ-OH)

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter20: Organic Chemistry

Section: Chapter Questions

Problem 125AP

See similar textbooks

Related questions

Q: Consider the molecule N-ethyl-N-methyl-3-iodo-4-methyl hexanamide. Draw it and give the two…

Q: b) CH-CH-CH-OH 5. Complete the following oxidation reactions for alcohols. Draw the structure of the…

A: These are the Reactions in Which alcohol group is oxidized to Ketone or aldehyde depending upon…

Q: Select the general class of compounds you would expect to have the highest boiling point. A.…

A: Ans - > D) Alcohol Because alcohol have Intermolecular hydrogen bonding. Required high energy…

Q: CH,OH O CH,OH Но ÓCH,CH, ΟΗ ΟΗ b. НОСН OCH,CH,CH, OH OH

A: The explanation is given below-

Q: Fill in the blanks: Identify the functional groups. CH2C-OCH3

A: A functional group are group of atoms or molecules which are used to determine the properties of an…

Q: OH

Q: TRUE OR FALSE: Dilute phosphoric acid is a dehydrating agent * O TRUE O FALSE Grignard Synthesis is…

A: 1. False . Because concentrated phosphoric acid acts as dehydrating agent. 2. False. Grignard…

Q: Consider the following compounds: ОН B C A E F H OH A) Which of these compounds can be reduced to…

A: There are some organic molecules which are as follows --- A) It is a compound containing alcohol…

Q: Name the functional group Si-O-Si and C-O-O

A: The groups which are responsible for the characterstics of a compound are called functional groups.

Q: CH3 CH-CH-CH-ОН

A: Condensed structural formula for given alchol is (CH3)2CHCH2OH OXIDATION OF ALCHOL

Q: Often the main functional group of a molecule can be determined from the name. Fill in the blank of…

A: 1. Functional group in glycerol = -OH (alcohol) Glycerol contains 3 -OH groups in its structure.…

Q: The monomers and H2N- -NH2 но— -(CH2)«- would react with each other to form a polycarbonate a…

A: The reactant monomers given are,

Q: 3. Write the condensed structural formula of the organic products for ethyl ethanoate when it reacts…

A: On reaction of NaOH and H2O/HCl the following products are formed

Q: The monomers NH2 and HO-C (CH FOH would react with each other to form a polyamide a polycarbonate a…

Q: what is the name of CH3COO-

A: CH3COOH (aq) + H2O(l) <---> CH3COO-(aq) + H3O+(aq) According to Lewis Concept, A substance…

Q: Are n-hexane and 1-hexene lipids?

A: The question is based on the concept of biomolecules. we have to identify whether the given…

Q: Name each carboxylic acid or ester. c. CH;-CH-CH2-CH2-CH2-C-OH CH,

A: Given,

Q: Q2 Decide whether it's True or False in each of the following? 1- Reaction of 2,3-dibromohexane with…

A: Note: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question…

Q: 3. The reaction of water with alkene to produce an alcohol is a/an C. Combustion D. Addition…

A: Addition reaction is the reaction which helps in conversion of alkene into alcohol.

Q: 2. Can tertiary alcohols be oxidized? Why or why not?i beh

A: In tertiary alcohols, the -OH group is attached to the carbon that is attached to the three alkyl…

Q: Consider erucic acid whose formula is CH3(CH2)7CH=CH(CH2)11COOH. It is a. Two of the choices are…

A: Omega fatty acids- these are long chain of hydrocarbons in which the fatty acids are attached at the…

Q: Refer to the following structures: K cont mo NH₂ CH₂-CH-C-OH OI, II, III OI, VI O III, V OI, IV OVI…

A: Esters are compounds with R-CO-R group.

Q: what are the functional groups in Adenosine Triphosphate

A: Adenosine triphosphate is known as ATP.

Q: Explain the Functional group of Compounds Containing a C=O Group ?

A: Carbonyl group It is a functional group containing carbon atom double bonded to oxygen atom. The…

Q: Is the compound CH3CH=CH2 saturated or unsaturated? Explain.

A: Saturated Hydrocarbons — contain only carbon- carbon single bonds. Saturated hydrocarbons are named…

Q: what is the correct IUPAC name for Ca(C₂H₃O₂)₂?

A: The IUPAC nomenclature of inorganic chemistry is a systematic method of naming inorganic chemical…

Q: 3. What is the clinical significance of the sodium nitroprusside test? 4. What is the basis of the…

Q: Draw the chemical structures for ethyl acetate, acetone, methyl alcohol, and n-hexane.

Q: When an carboxylic acid reacts with an alcohol, the product is called a(n) a. amide b. diester c.…

A: Carboxylic acid has carboxyl group (C(=O)(OH) attached to an R-group. General formula is R-COOH,…

Q: 24.48 Circle and name the functional group in cach compound. a. CH-C-OH b, 0=C-OH 16,17 CH,CHCH,

Q: Draw the structure of 5‑methyl‑3‑heptyne.

A: Parent chain (Longest chain) contains seven carbons. triple bond (C≡C) is at 3rd carbon and Methyl…

Q: CH-C-CH;-CH, 16. Name the functional group shown in the figure above. e aldehyde d. ketone A ester b…

A: The functional groups in any organic molecule are the substituent that causes the molecule to show…

Q: Question 32 Chemical reactions involving alkanes in which hydrogen atoms are removed and the product…

Q: Write the structural formula of the ester that, when hydrolyzed, would yield the following:

A: Ester under hydrolysis gives carboxylic acid and alcohol. In ester the carbonyl carbon group…

Q: 1. What is the product of this reaction? Also, name the functional groups present in the product. O…

A: Since you are posted with multiple questions. As per the rule, I am answering the first question…

Q: Draw structures for the following compounds. Show all of the hydrogen atoms in the molecules.…

Q: Which of the following compounds is a fatty acid? А. HO, В. NH2 C. С. HOʻ D. /

A: Compounds containing -COOH group in their structure is considered as carboxylic acid. Fatty acids…

Q: Write the reaction equation of hydrochloric acid, HCl, reacting with triethylamine (CH3CH2)3N.

A: CH3CH23NTriethyl amineAmines are considered as a derivative of Ammino replacement of one , Two or…

Q: 4. The organic starting materials for the preparation of an ester could be C. a ketone and alcohol A…

A: The organic starting materials for the preparation of an ester is by reaction of an acid and alcohol…

Q: `H A В а. Which of the following compounds are considered non-polar? b. Which of these compounds has…

A: The questions are based on the concepts of organic chemistry. amines contain intermolecular hydrogen…

Q: 3) the complete combustion of ethanol 4) an elimination reaction of 2-butanol

A: Alcohols are the compounds that contain the functional group -OH. Alcohols undergo combustion…

Q: what is the major product formed in the hydration reaction of 5-ethyl-2-methyl-2-hexane?

A: Acid catalyzed hydration of alkene. Correction in question it's hexene not hexane if hexane…

Q: Give the name for this molecule: ОН CH3CH2CH2-C- CH2CH3 | CH,CH3

A: The name of the given Molecule will be completely based on IUPAC Nomenclature -

Q: A carboxylic acid reacts with water to form a carboxylate ion and H,O*. Complete the reaction.…

A: Acids dissociate in water to form hydronium ions and a conjugate base. Strong acids dissociate…

Q: -C - CH2 - C

A: As the compound contains C=O And this group is bonded with carbon in both sides.

Q: 5- Write down the type of 2-methyl-2-propanol?

A: The presence of one or more hydroxyl (-OH) groups attached to the carbon atom in a chain of…

Concept explainers

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.

Question

100%

4. What is the correct formula for the ester produced when ethyl alcohol, CH3CH2-OH, is reacted
with butyric acid (CH,CH,CH,-Ĉ-OH)
a. CH,-C-CH,CH,CH,CH,
b. CH,-Ċ-O-CH,CH,CH,CH,
c. CH,CH,CH,-Ĉ-O-CH,CH,
Explain your answer:

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Determine the products of each carboxylic acid reaction. a. CH3-CH2-CH2-CH,-C-OH + H,SO, CH, — CH,— он HO. b. CH2 heat CH2 C-OH CH2
Name each aldehyde or ketone. CH, CH, c. CH3-C-CH-CH-CH-C-H ČH,
4. What is the correct formula for the ester produced when ethyl alcohol, CH3CH₂-OH, is reacted i-OHD with butyric acid (CH3CH₂CH₂-C-OH) a. CH3-C-CH,CH,CH,CH, -CH₂CH₂C i-o c. CHỊCH,CH,-C-O-CH,CH, Explain your answer: Co-CHỊCH, b. CH-C-O-CH,CH,CH,CH3
Question 18.c of 20 Aldehydes and ketones are common carbonyl functional groups. Identify the structures and provide names of these molecules. Provide a systematic name for this structure. سکتے 5- H 1- 4- cyclo tert- 6- di n- tri 3- 2- sec- hex eth but Submit +
614 Give the IUPAC name for each of the following 5-14 carboxylic acids. a. CH3-CH2-CH2-CH2-C-OH CH3 CH3 bilk b. CH—CH-СН,—С—ОН CH3 CH3 O c. CH3-CH-CH-C-OH CH-CH—С-ОН d. CH3-CH,—СH,—СООН
H3C. H3C CH3 Br 1-propanol
What is the systematic IUPAC name for the given compound? CH3 CH3 CH;CHCH,CH,CH2 -Ń-CH3 a. N-methyl-4-methylhexan-1-amine b. 2,4-dimethylhexan-1-amine c. 2,2,N-trimethylpentan-1-amine d. N,N,4-trimethylpentan-1-amine
9. Assign an IUPAC name to each of the following compounds. 2. a. CH3-C-O-C-CH2-CH, b. CH3-CH2-CH-CH-C-CI L. C. CH3-CH-CH-C-Cl ČH3 CH3 d. CH3-CH-C-0-C-H Draw the structures of the esters formed by reacting the following substances 1 molecule methanol and 1 molecule phosphoric acid 2 molecules methanol and 1 molecule phosphoric acid 1 molecule methanol and 1 molecule nitric acid 1 molecule ethylene glycol and 2 molecules of nitric acid 0. A. В. C, D.
College Chem II CHE 132 Alcohols & Ethers - Naming & Reactions 1. Name the following compounds. For a-d, indicate whether the compound is 1,2, or 3. b) CH a) CH-CH-CH-CHy CH-al-CH-CHy d) OH c) CHy f) CHy-CH- CH-CHy e) CHICHS 8) CHy-CH-CHy h) CHy-CH-0-CH-CHICHY CH2 CHy-CH-CH3
1. Give the IUPAC name of the following compound. CH,CH,CHCH,CH,CH,CH, c. CH,CH,CH,C(CH,CH,), b. CH,CH,CHCH,CHCH,CH,CH, ČH, ČH3 a.
CH,CH,CH,-OH Draw the structure of the product expected when each of the following alcohols is reacted with a sulfuric acid catalyst au the temperature indicated. H,SO, CH,-CH-CH, 180°C a. OH H,SO, CH, — CH—СH,—ОН 180°C b. CH; H,SO, CH-CH-OH 140°C с. CH, CH,-CH-CH,-CH, H,SO, d. 140°C d. OH
Which of the following compounds are esters? || a. CH,-0-CH,-C-CH,-OH C-0-CH,CH, b. CH,-0-CH, C. d. 0-CH,