Q 26 please 21)22)23)24)25)26)27)Which one of the following statements is true at constant pressure and temperature?a) AH = AE - PAV.c) AH = AE+RTAngThe enthalpy can be defined asa) H= AE + PVc) H=E+ PVWhat is the entropy of the following arrangement (3 left and 1 right) in the box having four molecules?KB= 1.38×10-23 J/K,a) 1.91x10-23 J/Kc) 8.56×10-23 J/K28)Calculate boiling point of a liquid,16 J/mole?a) 273 Kb) AE=AH+PAVd) AE=AH+RTAngb) H= E + APVd) H=E-PVb) 9.42×10-23 J/Kd) 1.56×10-23 J/Kenthalpy of vaporization is 6 KJ/mole and entropy changec) 375 Kabsd) 273 °Cb) 375 °CConsider the hypothetical reaction: X(g) + 2Y(g) →→ XY2g),A[Y]AtWhat is the rate of formation of XY2(g)a) 5.0 x 10-2 mol L-¹ sec¹c) 1.0 x 102 mol L¹ sec¹=-5.0x102 mol.L'.sec¹Which is the correct rate law?a) ratek [A] [B]c) ratek [A] [B]b) -2.5 × 10-² mol L-¹ sec¯¹d) 2.5 × 102 mol L-¹ sec¹How does a catalyst increase the rate of a chemical reaction?a) By changing the magnitude of the enthalpy change.b) By providing a pathway for the reaction that has a lower activation energy.c) By decreasing the potential energy of the productsd) By increasing the potential energy of the reactantsThe rate of a chemical reaction will be increased by all of the following factors EXCEPTa) the presence of a high activation energyc) an increase in temperatureFor the next 3 questions, use the proposed mechanism for a given chemical reaction shown below.Step 1: A + BF (fast)Step 2: F+ AC+ G (slow)Step 3: G+ AC+D (fast)b) the presence of a catalystd) increasing the concentration of the reactantb) rate=k [A] [B] [F] [G]d) rate = k [A] [B]

Q 26. This question belong to Chemical Kinetics that is Effect of catalyst on the rate of reaction.

26) How does a catalyst increase the rate of a chemical reaction? a) By changing the magnitude of the enthalpy change. b) By providing a pathway for the reaction that has a lower activation energy. c) By decreasing the potential energy of the products d) By increasing the potential energy of the reactants

26) How does a catalyst increase the rate of a chemical reaction? a) By changing the magnitude of the enthalpy change. b) By providing a pathway for the reaction that has a lower activation energy. c) By decreasing the potential energy of the products d) By increasing the potential energy of the reactants

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter16: Thermodynamics: Directionality Of Chemical Reactions

Section16.3: Measuring Dispersal Of Energy: Entropy

Problem 16.3CE

See similar textbooks

Similar questions

For the process A(l) A(g), which direction is favored by changes in energy probability? Positional probability? Explain your answers. If you wanted to favor the process as written, would you raise or lower the temperature of the system? Explain.
Given that H f for HF(aq) is -320.1 kJ/mol and S for HF(aq) is 88.7 J/mol K, find Ka for HF at 25C.
Explain why absolute entropies can be measured.
The synthesis of glucose directly from CO2 and H2O and the synthesis of proteins directly from amino acids are both non-spontaneous processes under standard conditions. Yet it is necessary for these to occur for life to exist. In light of the second law of thermodynamics, how can life exist?
Under what conditions is the entropy of a substance equal to zero?
Appendix J lists standard molar entropies S, not standard entropies of formation rS. Why is this possible forentropy but not for internal energy, enthalpy, or Gibbsfree energy?
The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.
Explain why the statement No process is 100 efficient is not the best statement of the second law of thermodynamics.
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)
Use data from Appendix D to calculate the standardentropy change at 25°C for the reaction CH3COOH(g)+NH3(g)CH3NH2(g)+CO2(g)+H2(g) Suppose that 1.00 mol each of solid acetamide, CH3CONH2(s), and water, H2O(l), react to give thesame products. Will the standard entropy change belarger or smaller than that calculated for the reactionin part (a)?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
When ammonium chloride is added to water and stirred, it dissolves spontaneously and the resulting solution feels cold. Without doing any calculations, deduce the signs of G, H, and S for this process, and justify your choices.