2. How many chiral carbon atoms are inthe following compound?CH2(OH)CH(OH)CH(OH)CH(OH)CH;OHa) 1b) 2c) 3d) 4

A chiral carbon atom or asymmetric carbon atom is one whose four valencies are occupied by four…

Answered: 2. How many chiral carbon atoms are in…

Science

Chemistry

2. How many chiral carbon atoms are in the following compound? CH:(OH)CH(OH)CH(OH)CH(OH)CH;OH a) 1 b) 2 c) 3 d) 4

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter10: Fuels, Organic Chemicals, And Polymers

Section: Chapter Questions

Problem IISP

See similar textbooks

Related questions

Q: Which of the following compounds would be optically active? For those that are draw the skeletal…

A: Identify which having chiral carbon (optically active) ---

Q: What is the configuration of the two chiral centers in the following molecule?

A: Structure is Given Configuration of the two chiral center = ?

Q: Draw molecules for the formula C5H10O with functional group alcohol and an ether with an R chiral…

Q: Draw a small circle around the chiral centers in the following molecule NH2 Br

A: The chiral centres are defined as the C centres which contains each valency different from the…

Q: How many Chiral centers are there in a molecule of ethanol ? CH3CH2OH

A: Since in ethanol we dont have any carbon which is attached to all 4 different substitutes hence…

Q: Mark each chiral center in the following molecule with an asterisk. How many stereoisomers are…

Q: How many chiral C's does the following molecule have? H3C H H CH3 HO H3C

A: Given:

Q: Which of these compounds is expected to be optically active at room temperature? COOH H OH CH CH,…

Q: D) Isocitraté 25) In each compound mark any chiral carbons

A: Dear student I have given answer to your question in the image format.

Q: d) е) f) ОН ОН с 8 о CI ОСН3

Q: 4 Indicate the configuration (R or S) around the chiral carbon(s) in the following compound.…

A: A molecule is said to be Chiral if it has a chiral centre. A chiral centre means a carbon with four…

Q: How many chiral centers are present in the following compound? OH

A: Stereochemistry is a branch of chemistry that deals with the study of relative 3D-arrangement of…

Q: Circle and name the functional groups in the following molecule(Hint:7). Place an * at each chiral…

A: Functional group can be defined as the groups of atoms which is responsible for characteristic…

Q: H 0:

A: Chiral Carbons: The carbon atom that has four different groups attached to it is called as the…

Q: How many chiral centers are in each of the following molecules? Mark each one with an asterisk. (a)…

A: Since you have posted questions with multiple subparts, we will solve first three subparts for you.…

Q: Mark each chiral center in the following molecule with an asterisk. How many stereoisomers are…

A: Chiral center is the carbon which is attached to four different groups. This carbon center is…

Q: a. Do the following compounds have any asymmetric centers? b. Are the compounds chiral? 1. CH2=C=CH2…

A: 1. CH2=C=CH2 - no asymmetric centers.

Q: Designate the configuration of each chiral center in the following molecules as R or S. (a) (b) (c)…

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: OH OH A) В) D) E) но HO OH 12.) The molecule with the most chiral carbon atoms from the drawings…

A: A chiral carbon is a carbon atom that is attached to four different types of atoms or groups of…

Q: Which of the letters (a-c) represent a chiral carbon in the molecule? CH3 a CH;CHCH2CHCH3 | b CI O b…

A: Chiral carbon ia a carbon which has all four different group attached.

Q: Which of the following structures represents a chiral compound? CH3 CH3 CH CH, CH, CH, CH OH CH3 H…

Q: 2. Which of the following compounds are optically active? Identify the chiral carbon with an asteris…

A: “Since you have posted a question with multiple sub-parts, we will solve the first three subparts…

Q: c) For the following compound identify how many chiral carbons present and how many isomers are…

Q: The structure shown below is 3-fluoro-2-butanol. What is the configuration of the chiral centers? A)…

A: First convert Newman projection to flying wedge and then determine the absolute configuration.

Q: Indicate whether the circled carbon atom in cach of the following molecules is a chiral center. a.…

A: A chiral centre is the C having 4 different substituents.

Q: Part 1 1 Indicate the configuration (R or S) around the chiral carbon(s) in the following compound.…

A: Here we are required to find the configuration of chiral carbon.

Q: 3 Indicate the configuration (R or S) around the chiral carbon(s) in the following compound.…

Q: OH OH A В OH

A: Optical activity - it is defined as the ability of substance to rotate plane of polarization of…

Q: Is 3-chloro-3-methylhexane chiral?

A: Chiral means asymmetric in such a way that the structure and its mirror image are not…

Q: This molecule has how many chiral centers in it? H. 1 2 H-C-OH НО-с-Н H-C-OH 5. H-C-OH 6, CH2OH

Q: Assign RS configuration to each chiral carbon in the following compounds

A: Enantiomers are different configurations of the same compound, a notational system had to be…

Q: How many chiral centers are there in the following molecule (the naturally occurring stereoisomer is…

A: A chiral center is defined as an atom that possesses four different groups bonded to it in such a…

Q: Mark each chiral center in the following molecules with an asterisk. How many stereoisomers are…

A: The structure of chemical compound can be represented as structural formula. A structural formula…

Q: Mark each chiral center in the following molecules with an asterisk. How many stereoisomers are…

A: Chiral centers are those carbon which carry 4 different substituents attached to it. Stereoisomers…

Q: Give the IUPAC name of the following alcohols. Please place asterisks to denote chiral centers. a.…

A: NOTE: please note according to our policy , we can only answer first three subparts of a question.…

Q: 2800-3000 9. rcle the chiral carbons in this molecule: CI H-C CH. Br Ci 10 These two structures,…

Q: How to complete A?

A: The chemical structure and absolute configurations are given in step 2.

Q: ÇI

A: Since you have posted a question with multiple sub- parts, we will solve first three sub- parts for…

Q: CH3 CH3 CH3 он

A: Chiral centre means Carbon which have 4 different valency

Q: Identify the chiral centers in following compound. a)10 b)9 c)5 d)8

A: An atom bonded with four different atoms/groups and having a non-superimposable mirror image is…

Q: Determine whether or not the following molecules are chiral: A) CH3CH2CHClCH3 B) CH3CCl2CH3 C)…

A: A molecule with atleast one chiral center and does not have any type of symmetry(plane of…

Q: H2 C which carbon is AC the chiral center? CH2-CH3

Q: How many chiral carbon can be seen on CH₃CHFCHFCH(CH₃)₂?

Q: Which of the following structures represents a chiral compound? CH, CH, CH, CH, CH, CH, CH, CH, QH…

A: Chiral compounds are the compounds which contains four different atoms attached to the central atom.…

Q: How many chiral carbons are contained in the following structure? CH,OH но-с-н H-C-OH ČH2OH O1 04 O…

Q: Q2. Write the number of chiral carbon atoms and the stereoisomers for the following compound. H3CH2C…

A: An asymmetric carbon atom or chiral carbon is a carbon atom that is attached to four different types…

Q: How many chiral centers are there in the following compound? Н—с — оН НО —с —н Н—с —он Н—с —он CH2OH

A: Chiral center- Center which is attached to 4 different atoms/ groups.

Concept explainers

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.

Question

100%

2. How many chiral carbon atoms are in
the following compound?
CH2(OH)CH(OH)CH(OH)CH(OH)CH;OH
a) 1
b) 2
c) 3
d) 4

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

1. How many chiral carbon atoms are in the following compound? CHCIBRCH2CHBRCH3 a) 0 b) 1 c) 2 d) 3 4. Which of the following compounds will not show optical activity? a) CH2CICHBRCI b) CH;CH(OH)CH3 c) CH;CH2CHĆICH3 d) CH2(OH)CH(NH2)COOH 2. How many chiral carbon atoms are in the following compound? 5. Three of the following projection formulas are the same compound. The other is the enantiomer. Which is the enantiomer? CH2(OH)CH(OH)CH(OH)CH(OH)CH2OH CH,OH c=0 a) 1 b) 2 c) 3 d) 4 ОН Н H-C=0 a) НО -H 3. The maximum number of ČHHOH stereoisomers theoretically possible for the compound below is: b) H-C =0 -CH2OH CH2(OH)CH(OH)CH(OH)CH(OH)CHO c) CH2OH a) 8 b) 6 c) 16 d) 4 H. - OH d) H-C=0
Cortisone is a compound that is used as an anti-inflammatory drug to treat 2) diseases like arthritis. Cortisone is a steroid which contains four rings (A, B, C and D), and has the following structure: он "OH Cortisone Provide the data to complete each of the following statements: The total number of chiral carbons (stereocentres) in Cortisone is The maximum number of stereoisomers possible is: The degree of unsaturation (IHD) of Cortisone is The total number of 2° hydrogens is The ring fusion between rings B and C is trans or cis? The absolute configuration of the carbon with * in the structure is The total number of n bonds is
Is 2-methyl-2-butanol chiral
what is the line structure?' a) CH3CH2CH2OH b) CH2CHCH2CH3 c) (CH3)2CHCH2CH2NH2
Which of the following compounds doesn't have a chiral carbon? B D HO. HO. NH, ОН OH
c) For the following compound identify how many chiral carbons present and how many isomers are possible. HO C4H6NOF OH OH d) Figure out elements of unsaturation for the following compound
CH3 CH CH CH3 CH3 H3C This compound has how many chiral carbons? O 2 03 O 5 01 0 4
Classify the following structures as isomers a, B, L or D isomers CH2OH c=0 HO C-H CH,OH
Draw molecules for the formula C5H10O with functional group alcohol and an ether with an R chiral center.
29) Which of the following compounds exhibits geometric isomerism? A) CH₂=CH₂ B) CH₂=CCI₂ C) 1₂C=CHI D) CHCI=CHCI E) (CH3)2C=CH-CH3 Ο Α OB OE OD OC
How many Chiral centers are there in a molecule of ethanol ? CH3CH2OH
Identify the configurations (R or S) of the chiral centers in the molecules below OH