The complete oxidation of glucose during cellular respiration is given by the equation below. The free energy change (AG) for the reaction is -2880 kJ/mol and the entropy change (AS) is 0.259 kJ x K-¹ x mol-¹ at 298 K. Calculate the enthalpy change (AH) for the reaction. C6H12O6 + 6 O2 → 6 CO₂ + 6H₂O Group of answer choices 746 kJ/mol 2957 kJ/mol -2803 kJ/mol 2803 kJ/mol

The complete oxidation of glucose during cellular respiration is given by the equation below. The free energy change (AG) for the reaction is -2880 kJ/mol and the entropy change (AS) is 0.259 kJ x K-¹ x mol-¹ at 298 K. Calculate the enthalpy change (AH) for the reaction. C6H12O6 + 6 O2 → 6 CO₂ + 6H₂O Group of answer choices 746 kJ/mol 2957 kJ/mol -2803 kJ/mol 2803 kJ/mol

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter16: Thermodynamics: Directionality Of Chemical Reactions

Section: Chapter Questions

Problem 48QRT

See similar textbooks

Similar questions

When a fossil fuel burns, is that fossil fuel the system? Explain your answer.
The chemical equation for the fermentation of glucose into ethanol is C6H12O6(s) 2 C2HsOH()+ 2 CO2(g) Using fH values at 25 C, calculate rH for this reaction. (See Question 23 for fH for glucose.)
The overall reaction that occurs when sugar is metabolized is C12H22O11(s)+12O2(g)12CO2(g)+11H2O(l) For this reaction, H° is -5650 kJ and G° is -5790 kJ at 25°C. (a) If 25% of the free energy change is actually converted to useful work, how many kilojoules of work are obtained when one gram of sugar is metabolized at body temperature, 37°C? (b) How many grams of sugar would a 120-lb woman have to eat to get the energy to climb the Jungfrau in the Alps, which is 4158 m high? ( w=9.79103mh, where w= work in kilojoules, m is body mass in kilograms, and h is height in meters.)
The combustion of methane can be represented as follows: a. Use the information given above to determine the value of H for the combustion of methane to form CO2(g) and 2H2O(l). b. What is Hf for an element in its standard state? Why is this? Use the figure above to support your answer. c. How does H for the reaction CO2(g) + 2H2O (1) CH4(g) + O2(g) compare to that of the combustion of methane? Why is this?
9.68 What are some features of petroleum that make it such an attractive fuel?
9.83 A student performing a calorimetry experiment combined 100.0 mL of 0.50 M HCl and 100.0 mL of 0.50 M NaOH in a coffee cup calorimeter. Both solutions were initially at 20.0°C, but when the two were mixed, the temperature rose to 23.2°C. (a) Suppose the experiment is repeated in the same calorimeter but this time using 200 mL of 0.50 M HCl and 200.0 mL of 0.50 M NaOH. Will the T observed he greater than, less than, or equal to that in the first experiment, and why? (b) Suppose that the experiment is repeated once again in the same calorimeter, this time using 100 mL of 1.00 M HCl and 100.0 mL of 1.00 M NaOH. Will the T observed he greater than, less than, or equal to that in the first experiment, and why?
Another step in the metabolism of glucose, which occurs after the formation of glucose6-phosphate, is the conversion of fructose6-phosphate to fructose1,6-bisphosphate(bis meanstwo): Fructose6-phosphate(aq) + H2PO4(aq) fructose l,6-bisphosphate(aq) + H2O() + H+(aq) (a) This reaction has a Gibbs free energy change of +16.7 kJ/mol of fructose6-phosphate. Is it endergonic or exergonic? (b) Write the equation for the formation of 1 mol ADP fromATR for which rG = 30.5 kJ/mol. (c) Couple these two reactions to get an exergonic process;write its overall chemical equation, and calculate theGibbs free energy change.
When 7.11 g NH4NO3 is added to 100 mL water, the temperature of the calorimeter contents decreases from 22.1 C to 17.1 C. Assuming that the mixture has the same specific heat as water and a mass of 107 g, calculate the heat q. Is the dissolution of ammonium nitrate exothermic or endothermic?
For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)
Acetic acid, a weak acid, was added to a beaker containing water at 25 C, giving a solution containing molecular acetic acid, hydronium ion, and acetate ion at equilibrium. The temperature did not change. (a) Is the solution process exothermic or endothermic? (b) Was the dissolving process and partial ionization spontaneous? (c) Did the entropy of the system increase or decrease? (d) Did the entropy of the universe increase or decrease?
In muscle cells under the condition of vigorous exercise, glucose is converted to lactic acid (lactate),CH3CHOHCOOH, by the chemical reaction C6H12O6 2 CH3CHOHCOOHrG = 197 kJ/mol (a) If all of the Gibbs free energy from this reaction wereused to convert ADP to ATP, calculate how many molesof ATP could be produced per mole of glucose. (b) The actual reaction involves the production of 3 molATP per mole of glucose. Calculate the rG for thisoverall reaction. (c) Is the overall reaction in part (b) reactant-favored orproduct-favored?