Suppose an ideal gas has a molar constant volume heat capacity of Cv = 5R. The gas reversibly undergoes an adiabatic expansion, doubling its volume. As the gas expands, its temperature drops from Ti to T_f. Find the final temperature T_f as a function of the initial temperature.

Suppose an ideal gas has a molar constant volume heat capacity of Cv = 5R. The gas reversibly undergoes an adiabatic expansion, doubling its volume. As the gas expands, its temperature drops from Ti to T_f. Find the final temperature T_f as a function of the initial temperature.

Physical Chemistry

2nd Edition

ISBN:9781133958437

Author:Ball, David W. (david Warren), BAER, Tomas

Publisher:Ball, David W. (david Warren), BAER, Tomas

Chapter2: The First Law Of Thermodynamics

Section: Chapter Questions

Problem 2.88E: The following are values of heat capacity for nitrogen gas; Temp K Cv J/mol. K 300 20.8 400 20.9 500...

See similar textbooks

Related questions

Q: None

A: 1st the alkene converted by meta-chloroperbenzoic acid to form epoxide then the attack of isopropyl…

Q: What is the difference between a saturated hydrocarbon and an unsaturated hydrocarbon? Unsaturated…

A: First option: This option is wrong. Unsaturated hydrocarbon has at least one multiple covalent bond.…

Q: could you answer this?

A: The difference in reactivity between Me₃SiCl and Me₃CCl with water can be attributed to the nature…

Q: Use the information provided to calculate the reaction rate. SO2 + 02-S03 Time (s) [SO2] (M) 241…

Q: Be sure to answer all parts. What are [H3O+], [OH¯], and pOH in a solution with a pH of 9.30? [H3O+]…

A: Step 1: pH = -log [H+] So, if pH is 9.30, -log[H+] = 9.30Hence, [H+] =…

Q: Please don't provide handwritten solution ...

A: Given, ΔH=+7.50 kJ/molΔS=+70.74 J/K mol=+70.74 x 10−3 kJ/K mol (1J=10−3kJ) To determine the…

Q: Give correct detailed Solution with explanation needed. Don't give Handwritten answer

A: The number of valence electrons of an element can be determined by the periodic table group…

Q: Which of the following is true concerning hydrocarbon molecules? Select all that apply.…

A: Hydrocarbons are organic compounds that are made up of only carbon (C) and hydrogen (H) atoms. They…

Q: (b) The molybdenum-carbon bond lengths of Mo(n 5-Cp) (CO)3(CH3), F, were determined by X-ray crystal…

Q: None

A: Step 1: As you go through the 5th row of the 2p block elements in the periodic table, you will find…

Q: What would be the predominant intermolecular attractive force between the two shown species? N OH

A: The predominant intermolecular attractive forces between two molecules, C₆H₅CH₃ (toluene) and…

Q: could you solve 1 and 2

A: Step 1:Step 2: Step 3: Step 4:

Q: None

A: To calculate the mole fraction of each gas, we need to find the number of moles of each gas and then…

Q: The reaction of Nb (CH2CMe3)3Cl2 with two equivalents of LiCH2CMe3 leads to the formation of…

Q: None

A: Ferrosilicate (Fesi) is a silicate mineral that contains iron. When it reacts with calcium oxide…

Q: Predict the freezing point of a solution of 456 g ethanol and 75.0 g KCI

A: The freezing point depression is given by the following equation:ΔT = i × K_f × molality Where:ΔT is…

Q: 5- Discuss the carbone dioxide capture and the stratigic plans?

A: Key references:…

Q: Energy, and Reaction Rates 25 pts st: Heat, Energy, and Reaction Rates Answered ✓ SKETCHPAD Question…

A: Thank you,Please rate my response.

Q: (iii) The molecular weight of polydimethylsiloxane can be controlled by addition of a silicon-based…

A: Step 1Step 2Step 3 Step 4

Q: (1) Draw the structure of the initial reactants to form the given ether compound (2) Williamson…

A: Step 1: Step 2: Step 3: Step 4:

Q: Reaction mechanism

A: Step 1: Step 2: Step 3: Step 4:

Q: NaH MeO i Br [C] THE D E C8H1002 A

Q: None

A: Step 1: Step 2: Step 3: Step 4:

Q: The decomposition of N2O5 can be described by the equation 2N₂O₂(soln) - 4 NO2 (soln) + O2(g)…

A: The balanced chemical equation is:2N2O5→4NO2+O2The rate of chemical equation will…

Q: could you solve this question?

A: The reaction rate, or kobs value, is determined by the rate at which the reactants collide and react…

Q: 9. (5 points) An over-all reaction consists of two elementary reactions which are 2NO2(g) → NO(g) +…

A: Step 1:Question 9:The elementary reactions are :2NO(g)→NO(g) + NO(g) slow…

Q: Balance the equation in basic conditions. Phases are optional. 2- equation: SO + Co(OH)2 SO3 +…

A: Thank you.

Q: None

A: In this question, we are given the amounts of reactants used in a reaction between Na₂S and CuSO₄,…

Q: Please be clear (That the images are not blurry)

Q: The answer is 3.84

A: Method 1:Given:Ka=1.8∗10−4[KCHO2] = 0.15 M (potassium format, the conjugate base)[HCHO2] = 0.12 M…

Q: Before acquiring a large area image, it is often desirable to quickly optimize the scan parameters…

A: Option c: This option is correct because The parameter(s) that should be held constant between the…

Q: Which reagent would you use to perform the following reaction? Reagent H ○ Chromic Acid (H2CrO4)…

A: Step 1: Step 2: Step 3: Step 4:

Q: None

A: The atomic mass numbers should balance on both sides of the equation.The atomic mass number of U-234…

Q: Please draw the molecular orbitals to help explain

A: Step 1: To draw the molecular frontier orbital scheme for Mo2(NMe2)6 starting from Mo(NMe2)3…

Q: When a liquid is converted to a gas there is an increase in entropy

A: Entropy is a measure of the randomness or disorder of a system. It is a fundamental concept in…

Q: None

Q: 8) = 1. Given: pH = 6.55 Wanted: [H] in mol/L? A. 2.82 × 10-7 M B. 3.05 × 10-7 M C. 3.38 x 10-7 M D.…

Q: By definition, what happens when an acid and base react? 0000 Water is formed. An ionic compound…

A: Definitions:Acids: Subatance that can donate a proton (H+ ion) or accept an electron pair in the…

Q: Which molecules are the main molecules associated with energy? a. carbohydrates b. lipids c.…

A: Carbohydrates, such as glucose, are a vital source of energy for many organisms. Glucose is a simple…

Q: In ethene the Z-axis is a C2 O H5 +Z H4 C3 C4 H3 H6 axis.

A: Step 1: Ethylene is not square shaped. In is rectangular. Step 2: so 90° rotation won't give you…

Q: Which molecules are the main molecules associated with energy? carbohydrates…

A: Carbohydrates are the body's main source of energy. They are broken down into glucose, which can be…

Q: ii) When the following compound undergoes ozonolysis, two products are formed (X and formaldehyde,…

Q: How will you distinguish p-anisaldehyde from 3- nitro benzaldehyde using 1H-NMR. Discuss the major…

A: Step 1: Step 2: Step 3: Step 4:

Q: None

Q: 3. Calculate the energy released when 10.g of water at 20.0°C are converted into ice at -10.0°C. You…

A: Given:…

Q: Answer the following questions: 1. Write the structure of the major organic product expected from…

A: Here is the explanation for each structure:a. No Reaction: In this reaction, the given compound does…

Q: Circle which of the following would be soluble in H2O

A: Step 1: Compound 1 , 2,3 can form strong hydrogen bonding with water. So they are very soluble in…

Q: The product of a hydrogenation reaction of an aldehyde or a ketone is an ester. Question 2 options:…

A: The reason is based on the chemical reactions involved in hydrogenation and ester…

Q: could you identify C?

A: C: Diethylphosphinous chloride (Et2PCl)D: Diethylphosphine (Et2PH)E: Lithium diethylphosphide…

Q: A platinum electrode is immersed into a solution of 10 mol m-3 KNO3 and poised at -1 V. (1) Sketch…

A: Part (i): Concentration Profile of K⁺ IonsHere's a sketch of how the concentration of K⁺ ions…

Question

help please answer in text form with proper workings and explanation for each and every part and steps with concept and introduction no AI no copy paste remember answer must be in proper format with all working

Suppose an ideal gas has a molar constant volume heat capacity of Cv = 5R. The gas reversibly undergoes an
adiabatic expansion, doubling its volume. As the gas expands, its temperature drops from Ti to T_f. Find the final
temperature T_f as a function of the initial temperature.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

What is the change in internal energy when a gas contracts from 377mL to 119mLundera pressure of 1550 torr, whileat the same time being cooled by removing 124.0J ofheat energy?
Assume that 1.20 g of benzoicacid, C6H5COOH, is burned in a porcelain dish exposed to the air.If 31, 723 J of energy is givenoff andthe surrounding temperature is 24.6C, calculate q, w, H,and U. Compare your answers to those from the previousproblem.
The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
The following are values of heat capacity for nitrogen gas; Temp K Cv J/mol. K 300 20.8 400 20.9 500 21.2 600 21.8 700 22.4 800 23.1 900 23.7 1000 24.3 1100 24.9 Using the general formula Cv = A BT C/T2, find values of A, B, and C that fit the given data.
Benzoic acid, C6H5COOH, is a common standard used in bomb calorimeters, which maintain a constant volume. If 1.20 g of benzoic acid gives off 31, 723 J of energy when burned in the presence of excess oxygen and in a water bath having a temperature of 24.6 C, calculate q, w, H, and U for the reaction.
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
A 1.00 mol sample of H2 is carefully warmed from 22 K to 40 K at constant volume. a What is the expected heat capacity of the hydrogen? b What is q for the process?
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
You did an experiment in which you found that 59.8 J was required to raise the temperature of 25.0 g of ethylene glycol (a compound used as antifreeze in automobile engines) by 1.00 K. Calculate the specific heat capacity of ethylene glycol from these data.
In the 1880s, Frederick Trouton noted that the enthalpy of vaporization of 1 mol pure liquid is approximately 88 times the boiling point, Tb, of the liquid on the Kelvin scale. This relationship is called Troutons rule and is represented by the thermochemical equation liquid gas H = 88 Tb, joules Combined with an empirical formula from chemical analysis, Troutons rule can be used to find the molecular formula of a compound, as illustrated here. A compound that contains only carbon and hydrogen is 85.6% C and 14.4% H. Its enthalpy of vaporization is 389 J/g, and it boils at a temperature of 322 K. (a) What is the empirical formula of this compound? (b) Use Troutons rule to calculate the approximate enthalpy or vaporization or one mole of the compound. Combine the enthalpy of vaporization per mole with that same quantity per gram to obtain an approximate molar mass of the compound. (c) Use the results of parts (a) and (b) to find the molecular formula of this compound. Remember that the molecular mass must be exactly a whole-number multiple of the empirical formula mass, so considerable rounding may be needed.
Use the two appropriate values of R to determine a conversion between L. atm and J.
If the heat capacity varies withtemperature, abetter form ofequation 2.9 isto solve q=TiTfnCT-t A 50.0-g sample of white phosphorus is heated from 298 K to 350K. If its molar heat capacity is CT- = 56.990.1202T J/mol.K, how much heat is needed?